Technetium(V) and Rhenium(V) Complexes with S-Substituted Diamide-Dithiol Ligands. Single Crystal Structure Analysis of Tetraphenylarsonium Oxo-[N,N′-Ethylenebis(2-mercaptoacetimido)rhenate(V)]
作者:Cheng-Hsien Lin、Shih-Tsorng Huang
DOI:10.1080/00945719608005112
日期:1996.3.1
The benzoyl-protected unsymmetrical diamide-dithiol ligands of the type C6H5COSCH2CONH(CH2)(2)NHCOCH(2)SR, H-3(ema)R, where R = (CH2)(2)CN, (CH2)(2)COOCH3 and (CH2)(2)CONHC6H5, have been synthesized. When these ligands were allowed to react with Na[TcO(eg)(2)] (eg = ethylene glycolato), TcO2(py)(4)Cl or ReO2(py)(4)Cl, dealkylation of the thioether side chain from the ligands occurred and [TcO(ema)](-) or [ReO(ema)](-) were formed. These anionic complexes were isolated as either Ph(4)As(+) or Et(3)NH(+) salts. The complex [Ph(4)As][ReO(ema)] was recrystallized in ethanol/water solution, and a single crystal X-ray structure determination was performed. The crystal data are: monoclinic, space group P2(1)/c, a = 12.252 (6) Angstrom, b = 13.713 (8) Angstrom, c = 17.691(8) Angstrom, beta = 79.08 (4)(0), V = 2950 (3) Angstrom(3), Z = 4, Dc = 1.778 Mg/m(3), R = 0.0295 and Rw = 0.0335. The reactions of H-3(ema)R with ReO(PPh(3))(2)Cl-3 afforded six-coordinated complexes ReO(PPh(3))(ema)R, which are neutral, lipophilic and air stable.