摘要:
Treatment of two equivalents of cis-5,15-bis(o-[2-nicotinoy-lamido]phenyl-2,8,12,18-tetraethyl-3,7,13,17-tetramethylporphyrinato nickel(II), [Ni(DPE)-(NH-CO-py)2], with [M(DMSO)4](ClO4)2 in methanol produces trinuclear complexes, [Ni(DPE)-(NH-CO-PY)2]2M(ClO4)2 where M is Pd or Pt. The trinuclear Ni2Pd complex crystallizes from CHCl3 to yield an octasolvate. An X-ray structure determination for [NiO2N8C56H52]2Pd(ClO4)2.8HCCl3 was carried out. Crystal data are as follows: monoclinic, P2(1/n) (No. 14), a = 14.378(7), b = 23.413(6), c = 21.140(6) angstrom, beta = 105.30(3)-degrees, V= 6865(4) angstrom, Z = 2, R = 0.076 and R(w) = 0.082.