摘要:
The nitrile derivatives Os3(CO)10(CNR)(NCMe) (2) have been prepared by the reaction of isocyanide complexes Os3(CO)11(CNR) (1) with Me3NO in the presence of CH3CN. The labile complex 2 on reaction with two-electron donor ligands L (L = CO, PPh3, PMePh2) gives Os3(CO)10(CNR)L (3). Treatment of 2 with propynoic acid (HC=CCO2H) in CH2Cl2 yields the hydrido complexes (mu-H)Os3(CO)10(mu2-OCOC=CH)(CNR) (4); however, complex 2 reacts with propynoic acid in acetonitrile to form complex 4 and the bridging aminocarbyne species Os3(CO)10(mu2-OCOC=CH)(mu2-C=NHR) (5) containing a unique bridging unidentate (mu2-eta1-oxo) carboxylate ligand. Molecular structures of Os3(CO)10(CNPr)(PPh3)(3a) and Os3(CO)10(mu2-OCOC=CH)(mu2-C=NHPr) (5a) have been determined by X-ray diffraction studies. Crystal data are as follows. 3a: P1BAR; a = 11.4611 (14), b = 11.6963 (19), c = 14.9661 (22) angstrom; a = 93.635 (12), beta = 73.633 (11), gamma = 117.325 (11)-degrees; V = 1705.0 (4) angstrom3, Z = 2; R = 4.2%, R(w) = 5.1%. 5a: P2(1)2(1)2(1); a = 9.4241 (23), b = 15.414 (4), c = 15.972 (3) angstrom; V = 2320.2 (9) angstrom3, Z = 4; R = 3.2%, R(w) = 3.5%.