A novel fluorinated ether compound useful as an inert medium is provided.
The compound is represented by the following formula (1) such as the compound represented by the following formula (1a) or the compound represented by the following formula (1b):
RF1OCFRF2CFRF2ORF1 (1)
F (CF2)4OCF(CF3)CF(CF3)O(CF2)4F (1a)
F(CF2)6OCF(CF3)CF(CF3)O(CF2)6F (1b)
wherein the symbols have the following meanings:
RF1 is a C4-7 linear perfluoroalkyl group; and
RF2 is a fluorine atom or a trifluoromethyl group.