摘要:
Spiro-N3P3(O2C12H8)(OC5H4N-2)(4) (L) is an efficient multi-site coordination ligand which binds with transition metal ions to afford the mononuclear complexes [LCu(NO3)(2)], [LCo(NO3)(2)] and [LZnCl2], In [LCu(NO3)(2)] the copper atom is six-coordinate with the cyclophosphazene ligand coordinating to the metal ion through one skeletal ring nitrogen atom and two nitrogen atoms of geminal pyridyloxy substituents in a eta(3)-gem-N-3 mode. The two nitrate ligands provide monodentate as well as chelating coordination. In [LCo(NO3)(2)] the coordination geometry around Co(II) is pentagonal bipyramidal with a 3N, 40 coordination environment. The cyclophosphazene ligand binds to the metal ion in a eta(3)-non-gem-N-3 mode. The two nitrate ligands function as chelating ligands and complete the coordination around cobalt. The coordination response of L in the complex [LZnCl2] is also eta(3)-non-gem-N-3. Two chloride ligands complete the coordination environment around zinc. (C) 2007 Published by Elsevier Ltd.