摘要:
The iron complex CpFe(CO)2I (1) undergoes a clean coupling reaction of the Fe-I bond with the Sn-C= bond of various trialkyltin acetylides 3SnC=CR' (R' = H, Pr, Bu, Ph) in the presence of a catalytic amount (5%) of (CH3CN)2PdCl2 to give the corresponding sigma-alkynyl metal complexes CpFe(CO)2C=CR' [R' = H (2), Pr (3), Bu (4), Ph (5)] in 60-70% yields. Under the same conditions, 1 equiv of complex 1, CpFe(CO)2I, in the presence of palladium, reacts with the 1-(trimethylstannyl)-1,3-butadiyne (CH3)3SnC=CC=CH (8) to form the iron complex CP(CO)2FeC=CC=CH (11) and 2 equiv reacts with 1,4-bis(trimethyl-stannyl)-1,3-butadiyne, (CH3)3SnC=CC=CSn(CH3)3 (10), to yield the bimetallic complex Cp-(CO)2FeC=CC=CFe(CO)2Cp (12) possessing the eta2(sigma,sigma)-1,3-butadiyne-1,4-diyl ligand bridging the two iron atoms.