中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
Cycloocta-1,5-diene;iridium;methyloxidanium |
12148-71-9 |
C18H34Ir2O2+2 |
|
—— |
carbonic acid 6-azido-hexyl ester 3-formyl-indol-1-ylmethyl ester |
912355-18-1 |
C17H20N4O4 |
|
—— |
cyclohexyl-[1-[cyclohexyl-(1-cyclohexylphosphanylidene-2,2-dimethylpropyl)indiganyl]-2,2-dimethylpropylidene]phosphane |
364604-99-9 |
C28H51InP2 |
|
—— |
(Cycloheptatrien-7-ylmethyl)methylether |
102535-83-1 |
C9H12O |
|
—— |
Chlor-lumisantonin |
28136-96-1 |
C15H17ClO3 |
|
—— |
Cyclopent-1-en-carbonsaeure-dibutylamid |
92329-43-6 |
C14H25NO |
|
—— |
carbon monoxide;2-diphenylphosphanyl-1-phenylethanone;iron |
143267-48-5 |
C43H34FeO5P2 |
|
—— |
chloro(trimethylamine-isocyanoborane)gold(I) |
727737-96-4 |
C4H11AuBClN2 |
|
—— |
cadmium chloride * 2.2'-dipyridyl |
33637-88-6 |
C10H8CdCl2N2 |
|
—— |
Cyclopropyl-[1-(4-methyl-1H-indol-3-yl)-meth-(E)-ylidene]-amine |
97302-43-7 |
C13H14N2 |
|
—— |
carbonylchlorohydrido(4-methylpyridine)-bis(triphenylphosphine)ruthenium(II) |
107982-73-0 |
C43H38ClNOP2Ru |
|
—— |
Cy5-NBA-COOH |
1448147-56-5 |
C38H41N3O10S2 |
|
—— |
[Cd(Me3N(+)CH2CO2(-))(NO3)]n(ClO4)n |
194477-67-3 |
C5H11NO2*Cd*ClO4*NO3 |
|
—— |
cis-[PtBr2(PPh2(4-catechol))2] |
879082-71-0 |
C36H30Br2O4P2Pt |
|
—— |
cyclodocosane;[diphenyl(12-tritylsulfanyldodecylsulfanyl)methyl]benzene |
102435-93-8 |
C22H44*C50H54S2 |
|
—— |
cis-N-methyl-8-formyloxy-1-azaspiro<5.5>undecane-2-one |
67613-83-6 |
C12H19NO3 |
|
—— |
Cyano-(3-oxo-cyclododecyl)-acetic acid ethyl ester |
32080-68-5 |
C17H27NO3 |
|
—— |
cis-3-<4'-(But-2-enyl-1-oxy)phenyl>propionsaeureethylester |
61493-86-5 |
C15H20O3 |
|
—— |
cyclotetracosa-1,3,7,9,13,15,19,21-octayne |
221890-38-6 |
C24H16 |
|
—— |
carbonic acid compound with N-(4-(((3,5-dimethylbenzyl)amino)methyl)benzyl)-3,5-dimethylaniline and 6,7,9,10,12,13,20,21,23,24,26,27-dodecahydrodibenzo[b,n][1,4,7,10,13,16,19,22]octaoxacyclotetracosine (1:1:1) |
1213270-63-3 |
CH2O3*C24H32O8*C25H30N2 |
|
—— |
copper(I) purine-6-thione bis(triphenylphosphine) bromide |
128834-68-4 |
C41H34BrCuN4P2S |
|
—— |
[Cu(II)(DL-α-lipoate)2]2 |
172372-30-4 |
C32H52Cu2O8S8 |
|
—— |
[Cd3(acetate)2(2-(N,N-dimethylamino)ethylselenolate)4] |
910132-47-7 |
C20H46Cd3N4O4Se4 |
|
—— |
carbanide;(2-methyl-6-propan-2-ylphenyl)-[[6-[(2-methyl-6-propan-2-ylphenyl)azanidylmethyl]pyridin-2-yl]methyl]azanide;zirconium(4+) |
208852-48-6 |
C29H39N3Zr |
|
—— |
cyclohexyl (Z)-5-phenylpent-2-enoate |
138964-34-8 |
C17H22O2 |
|
—— |
cadmium (μ-oxo)bis(tetracyanooxotechnetate(V)) decahydrate |
138666-78-1 |
C8N8O3Tc2*2Cd*10H2O |
|
—— |
[CpRu{η<sup>6</sup>-1-dimethylamino-2-(methylthio)benzene}]PF<sub>6</sub> |
1417393-10-2 |
C14H18NRuS*F6P |
|
—— |
Carbobenzoxy-N6=-nitro-L-arginal |
39740-54-0 |
C14H19N5O5 |
|
—— |
CF3CF2O-CCl2-CHClF |
942911-51-5 |
C4HCl3F6O |
|
—— |
(cis-1,2-dichloroethenyl)bis(dimethylglyoximato)(pyridine)cobalt(III) |
475645-88-6 |
C15H20Cl2CoN5O4 |
|
—— |
cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-yl-1,3-dimethylcyclopent-2-en-1-ol;iron(2+) |
220183-98-2 |
C17H20FeO |
|
—— |
chloro[(2’,4’,6’-triisopropyl-[1,1’-biphenyl]-2-yl)di-tert-butylphosphine]gold(I) |
1312108-97-6 |
C29H45AuClP |
|
—— |
cis-(Cl)-fac-(CO)-[(2,4'-bipyridine)Ru(CO)3Cl2]*H2O |
468720-75-4 |
C13H8Cl2N2O3Ru*H2O |
|
—— |
c<Phe(F)-Ala> |
136607-00-6 |
C12H13FN2O2 |
|
—— |
cis-4-formyloxy-1,2-piperidinedicarboxylic acid 1-ethyl, 2-methyl ester |
135690-69-6 |
C11H17NO6 |
|
—— |
cis-[PtCl2(CNC6H4COOH)2] |
954147-05-8 |
C16H10Cl2N2O4Pt |
|
—— |
(C5H5)2Er[OC(3,5-dimethylpyrazole)=NPh](THF) |
882662-71-7 |
C26H30ErN3O2 |
|
—— |
cis-1-phenyl-3-(ethylphenylamino)-4-(p-chlorophenyl)-2-azetidinone |
120638-38-2 |
C23H21ClN2O |
|
—— |
cis-Mo(CO)4((NC5H4)[(Ph2PNH)C(NH)]-4) |
325969-76-4 |
C22H16MoN3O4P |
|
—— |
Carbamic acid, dimethyl-,4-[[(diethylamino)methylene]amino]-3-pyridinyl ester |
142222-64-8 |
C13H20N4O2 |
|
—— |
cyclo[2,2-dimethyl-β-alanyl-(2S)-2-hydroxy-4-methylpentanoyl-(2E,5S,6S)-5-hydroxy-6-methyl-7-oxo-2-heptenoyl-3-chloro-O-methyl-D-tyrosyl] |
204397-62-6 |
C29H39ClN2O8 |
|
—— |
cis-[bis(diphenylphosphinomethyl)aniline]dichloroplatinum(II) |
1401420-45-8 |
C32H29Cl2NP2Pt |
|
—— |
copper;2-amino-2-sulfanylideneacetate |
155606-40-9 |
C4H4CuN2O4S2 |
|
—— |
cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-yloxy(diphenyl)phosphane;iron(2+) |
206068-23-7 |
C22H19FeOP |
|
—— |
[Co(uric acid(-1H))2(H2O)2] |
786635-92-5 |
C10H10CoN8O8 |
|
—— |
copper(II) dimethylglyoximate |
5327-14-0 |
2C4H7N2O2*Cu |
|
—— |
cis-[PtCl(9-ethylguanine-N7)(NH3)2]Cl |
88080-82-4 |
C7H15ClN7OPt*Cl |
|
—— |
cis-Cl2-trans-(PPh3)2Sb(OTf) |
1607473-37-9 |
CF3O3S*C36H30Cl2P2Sb |
|
—— |
cyanomercury(II) nitrate |
34237-08-6 |
CHgN*NO3 |
|
—— |
carboxymethyl-3,4,6-tri-O-benzyl-β-D-galactopyranoside-2-O-lactone |
959925-59-8 |
C29H30O7 |
|