中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
Phosphoric acid (E)-(R)-1,4-dimethyl-pent-2-enyl ester diethyl ester |
112452-66-1 |
C11H23O4P |
|
—— |
Prop-2-ynyl (2,3,4,6-tetra-O-acetyl-α-D-galactopyranosyl)-(1->3)-4-O-acetyl-2,6-di-O-benzoyl-β-D-galactopyranoside |
346420-68-6 |
C39H42O18 |
|
—— |
Pt(tbpy)Cl |
1428770-81-3 |
C11H7ClN6Pt |
|
—— |
Phosphoric acid mono-((3S,8R,9S,10R,13S,14S,16R,17R)-17-acetyl-17-hydroxy-10,13,16-trimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) ester |
75867-25-3 |
C22H35O6P |
|
—— |
piperidine-2(S)-carboxylic acid {4-[3-(5-chloro-2-hydroxy-phenyl)-1H-pyrazol-4-ylethynyl]-phenyl}-amide |
1020840-31-6 |
C23H21ClN4O2 |
|
—— |
phenyl 2-[(2R)-butan-2-yl]-7-fluoro-6-methyl-4-phenylmethoxy-1,3-dihydroisoindole-5-carboxylate |
1335555-95-7 |
C27H28FNO3 |
|
—— |
PhC(O)N(Pr(i))Zn(Bu(t))2Li*2thf |
585534-99-2 |
C52H92Li2N2O6Zn2 |
|
—— |
Phosphoric acid mono-{(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-(4-methoxy-phenyl)-6-oxo-1,6-dihydro-purin-9-yl]-tetrahydro-furan-2-ylmethyl} ester; compound with ammonia |
88868-85-3 |
C17H19N4O9P*2H3N |
|
—— |
Phosphoric acid mono-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-octyl-6-oxo-1,6-dihydro-purin-9-yl)-tetrahydro-furan-2-ylmethyl] ester; compound with ammonia |
88868-80-8 |
C18H29N4O8P*2H3N |
|
—— |
{P(CH2CH2PPh2)3Rh=C=CHCO2Et}BPh4 |
124224-61-9 |
C24H20B*C47H48O2P4Rh |
|
—— |
pentacarbonyl{(trimethylphosphito)benzylide}tungsten |
108389-47-5 |
C15H15O8PW |
|
—— |
phenyl 2,3,6-tri-O-benzoyl-β-D-galactopyranoside |
34213-07-5 |
C33H28O9 |
|
—— |
Propan-2-yl 4-[[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]methyl]piperidine-1-carboxylate |
1203553-50-7 |
C24H33NO4 |
|
—— |
Pyrrolidine-1-carbodithioic acid 2-oxo-cyclohexyl ester |
147723-49-7 |
C11H17NOS2 |
|
—— |
phenyl 3β-acetoxyandrost-5-ene-17β-carboselenoate |
76920-29-1 |
C28H36O3Se |
|
—— |
Pent-4-enyl 3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propanoate |
1448321-02-5 |
C19H33N3O6 |
|
—— |
phenyl-[<sup>3</sup><i>H</i>]acetonitrile |
73428-98-5 |
C8H7N |
|
—— |
[Pt(C6H3Me2-3,5)2(dmso)2] |
936707-79-8 |
C20H30O2PtS2 |
|
—— |
(phenyl)P(CH2CH2P(phenyl)2)2FeBr2 |
1393522-57-0 |
C34H33Br2FeP3 |
|
—— |
p-Nitro-diphenylketen |
20758-41-2 |
C14H9NO3 |
|
—— |
Perchlor-4-aza-acenaphthen |
40273-39-0 |
C11Cl9N |
|
—— |
Pentyl-(2,4)-dibromphenyl-fumarat |
109602-75-7 |
C15H16Br2O4 |
|
—— |
peroxophosphite |
57540-25-7 |
H2O4P |
|
—— |
(-)-phenylmethyl (2S,5S)-2-({[(1,1-dimethylethyl)(diphenyl)silyl]oxy}methyl)-5-[(2Z)-hept-2-en-1-yl]pyrrolidine-1-carboxylate |
1315127-27-5 |
C36H47NO3Si |
|
—— |
Propan-2-yl(propan-2-yloxymethylidene)oxidanium |
44844-54-4 |
C7H15O2 |
|
—— |
phenyl(12-tetracyclo[9.2.2.12,6.010,16]hexadeca-2,4,6(16),7,9,12-hexaenyl)methanone |
55431-99-7 |
C23H18O |
|
—— |
[Pt(diethylenetriamine)Cl]NO3 |
161066-98-4 |
C4H13ClN3Pt*NO3 |
|
—— |
prop-1-enyl 2-O-(2-O-acetyl-3,4,6-tri-O-benzyl-β-D-galactopyranosyl)-3,4-di-O-benzyl-β-D-xylopyranoside |
131267-22-6 |
C51H56O11 |
|
—— |
phenyl N-(5-indanyl)-3,3-bis(4-methoxyphenylthio)propionimidate |
1107009-32-4 |
C32H31NO3S2 |
|
—— |
pentacarbonyl(1-phenyl-3-methylphosphole)chromium(0) |
108589-20-4 |
C16H11CrO5P |
|
—— |
phenyl-(1-p-tolyl-1H-tetrazol-5-yl)-amine |
1308272-97-0 |
C14H13N5 |
|
—— |
pyridinium bis(6-methyl-4-oxo-4H-1,3-oxazin-2-yl)methylide |
85574-78-3 |
C16H13N3O4 |
|
—— |
Propyl-(3,4,4-trichloro-buta-1,3-dienylidene)-amine |
73880-19-0 |
C7H8Cl3N |
|
—— |
pentacarbonyl(isocyanacetonitrile)chromium |
169139-10-0 |
C8H2CrN2O5 |
|
—— |
p-[2-(benzyloxycarbonyl)ethyl]phenyl 2,4-di-O-acetyl-3,6-di-O-pivaloyl-β-D-mannopyranoside |
359686-64-9 |
C36H46O12 |
|
—— |
p-Methoxybenzyl-p-cyanophenyl-carbonat |
31558-48-2 |
C16H13NO4 |
|
—— |
(+)-Phellandrol |
5502-72-7 |
C10H18O |
|
—— |
[Pt(CSe3)(PEt3)2] |
785784-37-4 |
C13H30P2PtSe3 |
|
—— |
Potassium 6-beta-[S-2-(4-cyanophenyl)-1-hydroxy-2-oxoethyl]penicillanate |
109990-73-0 |
C17H15N2O5S*K |
|
—— |
p-acetamidophenyl tetra-O-acetyl-α-D-idopyranoside |
76514-12-0 |
C22H27NO11 |
|
—— |
phenyl N-allyoxycarbonyl-2-amino-4-O-acetyl-6-O-benzyl-2,3-N,O-carbonyl-2-deoxy-1-thio-α-D-glucopyranoside |
1537194-92-5 |
C26H27NO8S |
|
—— |
p-Toluolsulfonsaeure-<8-brom-naphthyl-(2)-ester> |
93259-50-8 |
C17H13BrO3S |
|
—— |
phthalazino(2,3-b) phthalazine-7-methoxy-5,12-dione |
56395-14-3 |
C17H14N2O3 |
|
—— |
(piperazinyldithiocarbamato)bis(oxinato)iron(III) |
145189-77-1 |
C23H21FeN4O2S2 |
|
—— |
phosphoric acid 3-chloro-2-diethoxythiophosphoryloxy-propyl ester diethyl ester |
17167-50-9 |
C11H25ClO7P2S |
|
—— |
P,P-di-t-butylphosphinothioic-N-ethylamide |
131325-99-0 |
C10H24NPS |
|
—— |
phenyl-carbamic acid-(2,4,5-trimethyl-tetrahydro-[3]furyl ester) |
101115-07-5 |
C14H19NO3 |
|
—— |
Propanimidamide, 2-(((4-(bis(2-chloroethyl)amino)phenyl)methylene)hydrazono)-N-hydroxy-N'-(4-methoxyphenyl)- |
126389-54-6 |
C21H25Cl2N5O2 |
|
—— |
Phosphorsaeure-aethylester-bis-<2,3-epoxy-propylester> |
17167-22-5 |
C8H15O6P |
|
—— |
Pyren, Tetracyanoethylen |
2399-97-5 |
C6N4*C16H10 |
|