中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
phenylpropynoic acid 4-methyl-thiazol-2-ylamide |
37469-37-7 |
C13H10N2OS |
|
—— |
[Pt2(7,8-benzoquinolate)2(μ-Cl)(μ-CC(t-Bu))]2 |
1274935-89-5 |
C64H50Cl2N4Pt4 |
|
—— |
Pusnmiwjzyaieb-xqhkeyjvsa- |
133519-41-2 |
C14H22O4S2 |
|
—— |
Perontan ZMF |
8067-88-7 |
C17H30FeMnN7S14Zn |
|
—— |
Piperidine-1-carbothioic acid (2-hydroxy-5-nitro-phenyl)-amide |
78720-34-0 |
C12H15N3O3S |
|
—— |
phenyl 4-methyl-3-keto-2-diazopentanoate |
1637436-59-9 |
C12H12N2O3 |
|
—— |
Pd(acac)(NO3) |
1352127-52-6 |
C5H7NO5Pd |
|
—— |
pentacarbonyl (sym-di-α-naphthylthiourea)molybdenum(0) |
40419-05-4 |
C26H16MoN2O5S |
|
—— |
phenyl 6-O-(2,3,4,6-tetra-O-acetyl-α-D-glucopyranosyl)-2,3,4-tri-O-acetyl-1-thio-β-D-glucopyranoside |
139299-88-0 |
C32H40O17S |
|
—— |
p-trifluoromethylphenyl 2E,6E-farnesyl carbamate |
1453113-09-1 |
C23H30F3NO2 |
|
—— |
p-formyl tetra-O-butoxycalix[4]arene |
209604-92-2 |
C48H56O8 |
|
—— |
[Pd(η3-C4H7)(2-(4-methyl-1H-pyrazol-1-yl)pyrimidine)]triflate |
857641-51-1 |
CF3O3S*C12H15N4Pd |
|
—— |
potassium 8-(1H-indazol-6-yl)-1-cyclopropyl-9-methyl-4-oxo-4H-quinolizine-3-carboxylate |
1392846-82-0 |
C21H16N3O3*K |
|
—— |
Pt(3-OMe-C6H4CH2CH2)Cl(6-Me-py-2-CHNPh) |
143667-97-4 |
C24H27ClN2OPt |
|
—— |
perchloric acid compound with guanidine and (4ar,11ar,15ar,22as,26as,33ar)-tetracosahydro-4a,33a:11a,15a:22a,26a-tributanotribenzo[b,k,t][1,4,7,10,13,16,19,22,25]nonaoxacycloheptacosine (1:1:1) |
98524-47-1 |
CH5N3*C42H72O9*ClHO4 |
|
—— |
Pd(η(3)-C4H7)(PO2F2)(Pcy3) |
155964-11-7 |
C22H40F2O2P2Pd |
|
—— |
Pentafluorophenylmethylene-triphenyl-λ<sup>5</sup>-arsane |
109384-54-5 |
C25H16AsF5 |
|
—— |
phosphoric acid [4-(3-aminophenyl)-1H-pyrazol-1-yl]methyl di-tert-butyl ester |
1190223-02-9 |
C18H28N3O4P |
|
—— |
phenyl-(3,4,6-tri-O-benzyl-2-deoxy-β-D-arabino-hexapyranosyl)ketone |
98933-78-9 |
C34H34O5 |
|
—— |
p-nitrobenzyl 2-<4-<<<<3-(tert-butyldimethylsilyloxy)propyl>thio>thiocarbonyl>thio>-2-oxo-1-azetidinyl>-2-(triphenylphosphoranylidene)acetate |
77597-21-8 |
C40H45N2O6PS3Si |
|
—— |
[Pt(bis(diphenylphosphino)methane)Cl(1-(diphenylphosphino)pyrene)](OTf)*CH2Cl2 |
1093075-99-0 |
CF3O3S*CH2Cl2*C53H41ClP3Pt |
|
—— |
p-<(trimethylsilyl)methyl>benzaldehyde <(triisopropylphenyl)sulfonyl>hydrazone |
109088-55-3 |
C26H40N2O2SSi |
|
—— |
[Pd(C(O)CH3)(1,10-phenanthroline)2][CF3SO3] |
410520-77-3 |
CF3O3S*C26H19N4OPd |
|
—— |
Propionic acid 2-[(Z)-3-(tert-butyl-dimethyl-silanyloxy)-propenyl]-phenyl ester |
208401-86-9 |
C18H28O3Si |
|
—— |
Pht<Phe-Ile-OH |
1098701-32-6 |
C23H24N2O5 |
|
—— |
Propionic acid 2-(4-cyclohex-1-enyl-phenyl)-propyl ester |
58494-66-9 |
C18H24O2 |
|
—— |
Phenyl-carbamic acid 3-methylsulfanylcarbonylamino-phenyl ester |
37798-34-8 |
C15H14N2O3S |
|
—— |
Phenanthren-9.10-chinonmonoimin-anhydrid |
7052-16-6 |
C28H16N2O |
|
—— |
Palmitinsaeure-pantethein-thioester |
56859-25-7 |
C27H52N2O5S |
|
—— |
pentabromocarbonylruthenate(III)(2-) |
135852-33-4 |
CBr5ORu |
|
—— |
[Pd(κ(2)-3,5-dimethyl-4-ethylpyrrole-2-carbothioaldehyde-1H)2] |
862122-85-8 |
C18H24N2PdS2 |
|
—— |
Phenoxy-acetic acid 1-(dimethoxy-phosphoryl)-allyl ester |
15269-06-4 |
C13H17O6P |
|
—— |
Perhydro-1,4-bis-<2>pyridylmethyl-2,5-dioxo-pyrazin |
6592-04-7 |
C16H28N4O2 |
|
—— |
(propan-2-yl-d7)zinc(II) bromide |
1160556-53-5 |
Br*C3H7Zn |
|
—— |
picric acid*3-cyanopyridine |
126416-03-3 |
C6H3N3O7*C6H4N2 |
|
—— |
piperidinium 1-(N-hydroxylato-2-NNO-azoxyphenyl)-3,3-pentamethylenetriazine |
89773-91-1 |
C5H11N*C11H15N5O2 |
|
—— |
PdPt(2-diphenylphosphinopyridine)2Cl2 |
78055-60-4 |
C34H28Cl2N2P2PdPt |
|
—— |
[PtMe(CF3CO2)(DPA)] |
883744-76-1 |
C13H12F3N3O2Pt |
|
—— |
perchloric acid compound with 3,6,12,15-tetraoxa-9-thia-1(2,6)-pyridinacyclohexadecaphane-2,16-dione and phenylmethanamine (1:1:1) |
73353-48-7 |
C7H9N*C15H19NO6S*ClHO4 |
|
—— |
Phth-DL-Val-DL-α-Hydroxy-isovaleriansaeure-benzylester |
103672-07-7 |
C25H27NO6 |
|
—— |
[[phenyl(pyridin-2-yl)methylidene]amino] hexadecanoate |
105769-57-1 |
C28H40N2O2 |
|
—— |
p-nitrobenzyl 2-<4-<<<<2-(tert-butyldimethylsilyloxy)ethyl>thio>thiocarbonyl>thio>-2-oxo-1-azetidinyl>-2-(triphenylphosphoranylidene)acetate |
77597-20-7 |
C39H43N2O6PS3Si |
|
—— |
phenylformylcyanoamide |
928715-69-9 |
C8H6N2O |
|
—— |
[(pentafluorophenyl)2Pt(μ-2,3,5,6-tetrafluorobenzenethiolate)2Pd(1,2-bis(diphenylphosphino)methane)] |
515843-11-5 |
C49H24F18P2PdPtS2 |
|
—— |
[Pd(II)(μ-acetate)4Co(II)]2(μ-acetate)2Pd(II)(pyridine)2 |
1044509-88-7 |
C30H40Co2N2O20Pd3 |
|
—— |
[PdF(benzo[h]quinoline(-H))(2,6-lutidine)] |
1207563-91-4 |
C20H17FN2Pd |
|
—— |
PtClMe(bipyrid)(maleic anhydr) |
119744-38-6 |
C15H13ClN2O3Pt |
|
—— |
phenylmethanamine O-(2-chlorophenyl) phosphorothioate |
1428326-63-9 |
C6H6ClO3PS*C7H9N |
|
—— |
p-[(E)-2-(1,4-benzodioxan-6-yl)propenyl]benzoic acid |
129791-87-3 |
C18H16O4 |
|
—— |
p-CF3-C6H4C(Bpin)CH(Bpin) |
1198171-96-8 |
C21H29B2F3O4 |
|