Synthesis and characterization of a series of trans-[(CO)5M{Ph2PX(CH2)3NCHC6H4-o-O}]2M′ (M = Mo; X = NH or M = Cr, W; X = CH2; M′ = Ni, Cu, Zn) complexes and the X-ray crystal structure of trans-[(CO)5MO{P(OCH2CMe2CH2O)NH(CH2)2-NCHC6H4-o-O}]2Cu
Synthesis and characterization of a series of trans-[(CO)5M{Ph2PX(CH2)3NCHC6H4-o-O}]2M′ (M = Mo; X = NH or M = Cr, W; X = CH2; M′ = Ni, Cu, Zn) complexes and the X-ray crystal structure of trans-[(CO)5MO{P(OCH2CMe2CH2O)NH(CH2)2-NCHC6H4-o-O}]2Cu