| 中文名称 | 英文名称 | CAS号 | 化学式 |
|---|---|---|---|
| —— | Pentaphenyl-(o-phenoxyphenyl)-disiloxan | 59024-64-5 | C42H34O2Si2 |
| —— | Propionic acid (1S,3S,5R,10S,13S,17S)-1-(1,3-dioxo-1,3-dihydro-isoindol-2-ylmethyl)-3-hydroxy-10,13-dimethyl-hexadecahydro-cyclopenta[a]phenanthren-17-yl ester | 59784-29-1 | C31H41NO5 |
| —— | {phenyl-[(<i>N</i>,<i>N</i>-phthaloyl-glycyl)-amino]-methyl}-phosphonic acid monoethyl ester | 62307-52-2 | C19H19N2O6P |
| —— | P-Cyclohexyl-N-p-methoxyphenyl-N'-m-tolylphosphonousdiamid | 56913-28-1 | C20H27N2OP |
| —— | p-Nitrophenyl-chinolin-8-carboxylat | 38860-54-7 | C16H10N2O4 |
| —— | potassium (benzo[b]thiophen-5-yl)trifluoroborate | 1000160-76-8 | C8H5BF3S*K |
| —— | potassium;2,4-dinitro-6-(2-thiocyanatoethoxycarbonyl)phenolate | 102976-79-4 | C10H6N3O7S*K |
| —— | p-Tolylsulphinylmethylbenzoat | 30988-85-3 | C15H14O3S |
| —— | pentacarbonyl(N,N-dimethylthioformamide)chromium(0) | 84749-54-2 | C8H7CrNO5S |
| —— | PEG<sub>2</sub>benzophenone alkyne carboxylic acid | 1254955-80-0 | C27H30N2O8 |
| —— | phenyl-3 heptatriene-1,3,5 | 77669-70-6 | C13H14 |
| —— | Pt(Me)(3-ClC6H3CH=NCH2C6H5)(PPh3) | 180069-48-1 | C33H29ClNPPt |
| —— | Propionic acid (11aR,11bR)-11a-ethyl-8-methoxy-2,3,4,5,11a,11b-hexahydro-1H-3a,9b-diaza-benzo[cd]fluoranthen-10-ylmethyl ester; compound with 2,3-dihydroxy-succinic acid | 62334-86-5 | C4H6O6*C24H30N2O3 |
| —— | phosphoric acid mono-((3a<i>S</i>)-2<i>t</i>-hydroxymethyl-6-oxo-(3a<i>r</i>,9a<i>c</i>)-2,3,3a,9a-tetrahydro-6<i>H</i>-furo[2',3':4,5]oxazolo[3,2-<i>a</i>]pyrimidin-3<i>c</i>-yl) ester | 52769-94-5 | C9H11N2O8P |
| —— | [Pt(H)(bis(di-tert-butylphosphino)methane)(3-(4,4'-bis(trifluoromethyl)biphenyl))] | 478930-59-5 | C31H46F6P2Pt |
| —— | phenyl N-(4-biphenyl)-3-(3-methylphenylthio)acrylimidate | 1107009-97-1 | C28H23NOS |
| —— | phenyl 2,3-di-O-benzyl-5-O-trityl-1-thio-α-D-arabinofuranoside | 1435740-24-1 | C44H40O4S |
| —— | Pd2(C6H4CH2NMe2)2(μ-Br)(μ-SC6H4Me-p) | 186540-42-1 | C25H31BrN2Pd2S |
| —— | Pyridin-α-hydrotetrafluorethenmethylsulfonat-Komplex | 25600-98-0 | C3H4F4O3S*C5H5N |
| —— | Perfluor-4,5-di-s-butyl-1,2-diazabicyclo<2.2.0>hexa-2,5-dion | 57684-61-4 | C12F20N2 |
| —— | Phosphoric acid 2-butylsulfanyl-ethyl ester bis-(2-chloro-ethyl) ester | 57879-07-9 | C10H21Cl2O4PS |
| —— | p-Nitrobenzaldehyd-N-methyl-N-(2,5-xylyl)-hydrazone | 51786-44-8 | C16H17N3O2 |
| —— | platinum(2+);triethylphosphane;tetrabromide | 69460-36-2 | C12H30Br4P2Pt2 |
| —— | Phenyl-(4-isothiocyanato)-n-decyl-sulfan | 15879-08-0 | C17H25NO2S2 |
| —— | [pyridine-2-C(H)=N(C6H5)]palladium(II) bis-trifluoroacetate | 454678-25-2 | C16H10F6N2O4Pd |
| —— | p-Dimethylaminobenzyliden-penta-(trifluormethyl)-anilin | 58956-77-7 | C20H11F15N2 |
| —— | Phenyl-acetic acid [1-(6-methyl-5-nitro-pyridin-2-yl)-meth-(E)-ylidene]-hydrazide | 84225-66-1 | C15H14N4O3 |
| —— | phenylthioethyl iodide | 139617-91-7 | C8H9IS |
| —— | (Phenyl-phenylamino-methyl)-phosphonic acid mono-(2-hydroxy-phenyl) ester; compound with morpholine | 59625-17-1 | C4H9NO*C19H18NO4P |
| —— | pinacol 3-phenyl-1-(trimethylsilyl)propane-1-boronate | 74213-46-0 | C18H31BO2Si |
| —— | phosphoric acid 2-chloro-1-ethylsulfanyl-vinyl ester dimethyl ester | 3592-54-9 | C6H12ClO4PS |
| —— | Phenylimino-phosphon-<2-methyl-phosphon-propionsaeure-O.O-diethylester> | 93151-19-0 | C15H24NO4P |
| —— | pent-4-en-1-yl 2-(1-diazo-2-methoxy-2-oxoethyl)benzoate | 1584160-54-2 | C15H16N2O4 |
| —— | [Ph<sub>3</sub>Sb(2,2'-bipyridine)(OTf)][OTf] | 1596270-26-6 | CF3O3S*C29H23F3N2O3SSb |
| —— | pyridine-2-carboxylic acid {(S)-3-[(benzo[1,3]dioxole-5-carbonyl)-methyl-amino]-2,2-dimethyl-4-phenyl-butyl}-amide | 1238071-69-6 | C27H29N3O4 |
| —— | Pentanoic acid [(2S,3S)-3-(4-bromo-benzyloxy)-2-hydroxy-3-((1S,2R)-2-hydroxy-indan-1-ylcarbamoyl)-propyl]-amide | 552887-38-4 | C25H31BrN2O5 |
| —— | [(PdCl(η3-1-Ph-C3H4))2(25,27-bis(2,2'-biphenyldioxyphosphinoxy)-26,28-dipropyloxy-p-tert-butyl calix[4]arene)] | 1041631-43-9 | C92H100Cl2O8P2Pd2 |
| —— | [Pt(acetonyl)(O,O-acac)(PPh3)] | 960395-83-9 | C26H27O3PPt |
| —— | pyrimido[1,6-a]indole-3-carboxylic acid (2-methoxyethyl)amide | 1396319-93-9 | C15H15N3O2 |
| —— | p-Acetamidophenyl-asparaginsaeureester (β) | 56253-55-5 | C12H14N2O5 |
| —— | Pentaacetylhaplanthin | 62346-18-3 | C32H34O15 |
| —— | phenyl-(2,3,5-triphenyl-isoxazolidin-5-yl)-aminooxyl | 58743-67-2 | C27H23N2O2 |
| —— | pentamethylbenzyl radical | 19121-64-3 | C12H17 |
| —— | [Pd(η3-1,3-Ph2C3H3)(κ2-P,P'-25,26-bis-(2,2'-biphenyldioxyphosphinoxy)-27,28-dipropyloxy-p-tert-butyl calix[4]arene)]PF6 | 1041631-47-3 | C89H95O8P2Pd*F6P |
| —— | p-Phenolidenhippursaeurenitril | 71651-10-0 | C16H12N2O2 |
| —— | Phenyl-(2-phenylsulfanyl-ethyl)-phosphinic acid isopropyl ester | 57322-04-0 | C17H21O2PS |
| —— | Perfluor-1,3-diisopropyl-2,5-diazabicyclo<2.2.0>hexa-2,5-dion | 57684-63-6 | C10F16N2 |
| —— | potassium (diethyl{1-ethyl-2-(ethyldimethylsilyl)-1-propenyl}hydroxyborate) | 125878-64-0 | C13H30BOSi*K |
| —— | [Pt(SC6H4CO2)(triphenylphosphine)(4-picolinic acid hydrazide)] | 303111-10-6 | C31H26N3O3PPtS |
| —— | pentaerythritol tetra-2-ethylbutanoate | 139116-32-8 | C29H52O8 |