中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
Pentaphenyl-(o-phenoxyphenyl)-disiloxan |
59024-64-5 |
C42H34O2Si2 |
|
—— |
Propionic acid (1S,3S,5R,10S,13S,17S)-1-(1,3-dioxo-1,3-dihydro-isoindol-2-ylmethyl)-3-hydroxy-10,13-dimethyl-hexadecahydro-cyclopenta[a]phenanthren-17-yl ester |
59784-29-1 |
C31H41NO5 |
|
—— |
{phenyl-[(<i>N</i>,<i>N</i>-phthaloyl-glycyl)-amino]-methyl}-phosphonic acid monoethyl ester |
62307-52-2 |
C19H19N2O6P |
|
—— |
P-Cyclohexyl-N-p-methoxyphenyl-N'-m-tolylphosphonousdiamid |
56913-28-1 |
C20H27N2OP |
|
—— |
p-Nitrophenyl-chinolin-8-carboxylat |
38860-54-7 |
C16H10N2O4 |
|
—— |
potassium (benzo[b]thiophen-5-yl)trifluoroborate |
1000160-76-8 |
C8H5BF3S*K |
|
—— |
potassium;2,4-dinitro-6-(2-thiocyanatoethoxycarbonyl)phenolate |
102976-79-4 |
C10H6N3O7S*K |
|
—— |
p-Tolylsulphinylmethylbenzoat |
30988-85-3 |
C15H14O3S |
|
—— |
pentacarbonyl(N,N-dimethylthioformamide)chromium(0) |
84749-54-2 |
C8H7CrNO5S |
|
—— |
PEG<sub>2</sub>benzophenone alkyne carboxylic acid |
1254955-80-0 |
C27H30N2O8 |
|
—— |
phenyl-3 heptatriene-1,3,5 |
77669-70-6 |
C13H14 |
|
—— |
Pt(Me)(3-ClC6H3CH=NCH2C6H5)(PPh3) |
180069-48-1 |
C33H29ClNPPt |
|
—— |
Propionic acid (11aR,11bR)-11a-ethyl-8-methoxy-2,3,4,5,11a,11b-hexahydro-1H-3a,9b-diaza-benzo[cd]fluoranthen-10-ylmethyl ester; compound with 2,3-dihydroxy-succinic acid |
62334-86-5 |
C4H6O6*C24H30N2O3 |
|
—— |
phosphoric acid mono-((3a<i>S</i>)-2<i>t</i>-hydroxymethyl-6-oxo-(3a<i>r</i>,9a<i>c</i>)-2,3,3a,9a-tetrahydro-6<i>H</i>-furo[2',3':4,5]oxazolo[3,2-<i>a</i>]pyrimidin-3<i>c</i>-yl) ester |
52769-94-5 |
C9H11N2O8P |
|
—— |
[Pt(H)(bis(di-tert-butylphosphino)methane)(3-(4,4'-bis(trifluoromethyl)biphenyl))] |
478930-59-5 |
C31H46F6P2Pt |
|
—— |
phenyl N-(4-biphenyl)-3-(3-methylphenylthio)acrylimidate |
1107009-97-1 |
C28H23NOS |
|
—— |
phenyl 2,3-di-O-benzyl-5-O-trityl-1-thio-α-D-arabinofuranoside |
1435740-24-1 |
C44H40O4S |
|
—— |
Pd2(C6H4CH2NMe2)2(μ-Br)(μ-SC6H4Me-p) |
186540-42-1 |
C25H31BrN2Pd2S |
|
—— |
Pyridin-α-hydrotetrafluorethenmethylsulfonat-Komplex |
25600-98-0 |
C3H4F4O3S*C5H5N |
|
—— |
Perfluor-4,5-di-s-butyl-1,2-diazabicyclo<2.2.0>hexa-2,5-dion |
57684-61-4 |
C12F20N2 |
|
—— |
Phosphoric acid 2-butylsulfanyl-ethyl ester bis-(2-chloro-ethyl) ester |
57879-07-9 |
C10H21Cl2O4PS |
|
—— |
p-Nitrobenzaldehyd-N-methyl-N-(2,5-xylyl)-hydrazone |
51786-44-8 |
C16H17N3O2 |
|
—— |
platinum(2+);triethylphosphane;tetrabromide |
69460-36-2 |
C12H30Br4P2Pt2 |
|
—— |
Phenyl-(4-isothiocyanato)-n-decyl-sulfan |
15879-08-0 |
C17H25NO2S2 |
|
—— |
[pyridine-2-C(H)=N(C6H5)]palladium(II) bis-trifluoroacetate |
454678-25-2 |
C16H10F6N2O4Pd |
|
—— |
p-Dimethylaminobenzyliden-penta-(trifluormethyl)-anilin |
58956-77-7 |
C20H11F15N2 |
|
—— |
Phenyl-acetic acid [1-(6-methyl-5-nitro-pyridin-2-yl)-meth-(E)-ylidene]-hydrazide |
84225-66-1 |
C15H14N4O3 |
|
—— |
phenylthioethyl iodide |
139617-91-7 |
C8H9IS |
|
—— |
(Phenyl-phenylamino-methyl)-phosphonic acid mono-(2-hydroxy-phenyl) ester; compound with morpholine |
59625-17-1 |
C4H9NO*C19H18NO4P |
|
—— |
pinacol 3-phenyl-1-(trimethylsilyl)propane-1-boronate |
74213-46-0 |
C18H31BO2Si |
|
—— |
phosphoric acid 2-chloro-1-ethylsulfanyl-vinyl ester dimethyl ester |
3592-54-9 |
C6H12ClO4PS |
|
—— |
Phenylimino-phosphon-<2-methyl-phosphon-propionsaeure-O.O-diethylester> |
93151-19-0 |
C15H24NO4P |
|
—— |
pent-4-en-1-yl 2-(1-diazo-2-methoxy-2-oxoethyl)benzoate |
1584160-54-2 |
C15H16N2O4 |
|
—— |
[Ph<sub>3</sub>Sb(2,2'-bipyridine)(OTf)][OTf] |
1596270-26-6 |
CF3O3S*C29H23F3N2O3SSb |
|
—— |
pyridine-2-carboxylic acid {(S)-3-[(benzo[1,3]dioxole-5-carbonyl)-methyl-amino]-2,2-dimethyl-4-phenyl-butyl}-amide |
1238071-69-6 |
C27H29N3O4 |
|
—— |
Pentanoic acid [(2S,3S)-3-(4-bromo-benzyloxy)-2-hydroxy-3-((1S,2R)-2-hydroxy-indan-1-ylcarbamoyl)-propyl]-amide |
552887-38-4 |
C25H31BrN2O5 |
|
—— |
[(PdCl(η3-1-Ph-C3H4))2(25,27-bis(2,2'-biphenyldioxyphosphinoxy)-26,28-dipropyloxy-p-tert-butyl calix[4]arene)] |
1041631-43-9 |
C92H100Cl2O8P2Pd2 |
|
—— |
[Pt(acetonyl)(O,O-acac)(PPh3)] |
960395-83-9 |
C26H27O3PPt |
|
—— |
pyrimido[1,6-a]indole-3-carboxylic acid (2-methoxyethyl)amide |
1396319-93-9 |
C15H15N3O2 |
|
—— |
p-Acetamidophenyl-asparaginsaeureester (β) |
56253-55-5 |
C12H14N2O5 |
|
—— |
Pentaacetylhaplanthin |
62346-18-3 |
C32H34O15 |
|
—— |
phenyl-(2,3,5-triphenyl-isoxazolidin-5-yl)-aminooxyl |
58743-67-2 |
C27H23N2O2 |
|
—— |
pentamethylbenzyl radical |
19121-64-3 |
C12H17 |
|
—— |
[Pd(η3-1,3-Ph2C3H3)(κ2-P,P'-25,26-bis-(2,2'-biphenyldioxyphosphinoxy)-27,28-dipropyloxy-p-tert-butyl calix[4]arene)]PF6 |
1041631-47-3 |
C89H95O8P2Pd*F6P |
|
—— |
p-Phenolidenhippursaeurenitril |
71651-10-0 |
C16H12N2O2 |
|
—— |
Phenyl-(2-phenylsulfanyl-ethyl)-phosphinic acid isopropyl ester |
57322-04-0 |
C17H21O2PS |
|
—— |
Perfluor-1,3-diisopropyl-2,5-diazabicyclo<2.2.0>hexa-2,5-dion |
57684-63-6 |
C10F16N2 |
|
—— |
potassium (diethyl{1-ethyl-2-(ethyldimethylsilyl)-1-propenyl}hydroxyborate) |
125878-64-0 |
C13H30BOSi*K |
|
—— |
[Pt(SC6H4CO2)(triphenylphosphine)(4-picolinic acid hydrazide)] |
303111-10-6 |
C31H26N3O3PPtS |
|
—— |
pentaerythritol tetra-2-ethylbutanoate |
139116-32-8 |
C29H52O8 |
|