| 中文名称 | 英文名称 | CAS号 | 化学式 |
|---|---|---|---|
| —— | [platinum(II)(dimethylamine)(pyrimidine)diiodide] | 1229343-08-1 | C6H11I2N3Pt |
| —— | pyridin-2-yl 4-((tert-butyldimethylsilyl)oxy)benzoate | 885053-28-1 | C18H23NO3Si |
| —— | Phenyl-phosphonic acid cyclobutyl ester m-tolyl ester | 25994-87-0 | C17H19O3P |
| —— | [PtMe(CH(CO2Me)2)(2,9-dimethyl-1,10-phenanthroline)] | 198965-75-2 | C20H22N2O4Pt |
| —— | Pt(C6H4(p-CN)N(PPh2)2)Cl2 | 898233-03-9 | C31H24Cl2N2P2Pt |
| —— | propane-1,3-diyl bis(3-(2-hydroxyphenyl)-1,6,6-trimethyl-5-oxo-2,7-dioxabicyclo[2.2.1]heptane-4-carboxylate) | 1453500-71-4 | C33H36O12 |
| —— | pentacarbonyl[2-ethoxy-2-methoxy-2-phenyl-1-(2-propenylamino)ethylidene]tungsten(0) | 108417-89-6 | C19H19NO7W |
| —— | Phenyl-phosphonodithioic acid O-ethyl ester S-(3-ethylsulfanyl-butyl) ester | 25918-38-1 | C14H23OPS3 |
| —— | Phenyl-(3-hydroxy-phenyl)-selenid | 876487-19-3 | C12H10OSe |
| —— | Pentafluorphenyl-undecafluor-cyclohexaphosphazen | 20651-80-3 | C6F16N6P6 |
| —— | Paracentronacetat | 26583-02-8 | C33H44O4 |
| —— | p-Dipropylsulfamoyl-benzoesaeure-(2-dimethylamino-ethylester) | 21787-23-5 | C17H28N2O4S |
| —— | Phe-(5'-N)dpApApA | 50629-46-4 | C39H47N16O17P3 |
| —— | Photoprotoporphyrin-dimethylester monoacetat | 28296-28-8 | C38H40N4O7 |
| —— | p-[(2-methyl-2-norbornyl)oxy]aniline hydrochloride | 56715-03-8 | C14H19NO*ClH |
| —— | Pyridin-2-thiosulfonsaeure-S-tert.-butylester | 24367-67-7 | C9H13NO2S2 |
| —— | p-Nitrobenzyliden-Derivat von 2-Hydrazinopyridazino<6,1-b>chinazolin-10-on | 27230-86-0 | C18H12N6O3 |
| —— | p-Acetamidophenyl-chinaldyl-keton | 27382-40-7 | C19H16N2O2 |
| —— | Paederosidic acid | 27088-47-7 | C18H24O11S |
| —— | Phosphoric acid mono-(3-bromo-2,2-dimethoxy-propyl) ester; compound with cyclohexylamine | 28029-26-7 | C5H12BrO6P*C6H13N |
| —— | Propionic acid (3aS,6S,7S)-6,7-bis-methoxycarbonylmethyl-3a,6-dimethyl-dodecahydro-cyclopenta[a]naphthalen-3-yl ester | 26686-23-7 | C24H38O6 |
| —— | pentacarbonyl{diethylcyanamide}tungsten | 142746-95-0 | C10H10N2O5W |
| —— | piperidin-2-yl-(6-trifluoromethyl-phenanthren-9-yl)-methanol | 50665-89-9 | C21H20F3NO |
| —— | Phenyl-acetic acid (Z)-3-ethoxy-2-methylsulfanyl-3-(4-nitro-phenyl)-1-phenyl-propenyl ester | 24838-48-0 | C26H25NO5S |
| —— | Propynoic acid (E)-3-benzo[1,3]dioxol-5-yl-allyl ester | 29584-61-0 | C13H10O4 |
| —— | Pyrrol-2-carbaldehyd-(4-<2>naphthyl-thiosemicarbazon) | 31396-99-3 | C16H14N4S |
| —— | Phenyl-<(1S,4R,5R)-4-piperidino-6,8-dioxabicyclo<3.2.1>oct-4-yl>ketonimin | 157039-25-3 | C18H24N2O2 |
| —— | Propionic acid (6S,9R,10S,11S,13S,17R)-17-(2-acetoxy-acetyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl ester | 23641-01-2 | C26H32F2O7 |
| —— | potassium salt of 2'-acetylcyclohexenylamino acetic acid | 80312-14-7 | C10H14NO3*K |
| —— | Phenyl-phosphonodithioic acid O-ethyl ester S-((E)-propenyl) ester | 25918-21-2 | C11H15OPS2 |
| —— | phenyl-phosphonodithioic acid <i>O</i>-ethyl ester <i>S</i>-[(morpholine-4-carbonylcarbamoyl)-methyl] ester | 39259-68-2 | C15H21N2O4PS2 |
| —— | Phenyl-<2,3-di-O-benzyl-4,6-didesoxy-4-(2,3:4,5-di-O-isopropyliden-D-arabino-pentiol-yl)-amino-α-D-glucopyranosyl>-(1->4)-2,3,6-tri-O-benzyl-α-D-glucopyranosid | 96727-48-9 | C64H75NO13 |
| —— | p'-Methoxy-ergotamin | 35721-28-9 | C34H37N5O6 |
| —— | [Pt(phosphorus tricyanide)2Cl2] | 688804-12-8 | C6Cl2N6P2Pt |
| —— | p-Isobutoxythiobenzoesaeure-N(2-diethylamino-ethyl)amid | 16531-33-2 | C17H28N2OS |
| —— | phenyl α-propyl-m-aminocinnamate hydrochloride | 93130-89-3 | C18H19NO2*ClH |
| —— | [(Pd(μ-O2CCH3)(C6H4CH2NHC6H5-C1,N))2] | 168063-36-3 | C30H30N2O4Pd2 |
| —— | {Pt((15)en)(H2O)Cl}NO3 | 115160-65-1 | C2H10ClN2OPt*NO3 |
| —— | (p-Me2C6H4)Cr(CO)2P(o-tolyl)3 | 148571-92-0 | C31H31CrO2P |
| —— | [Pt(κ2-2-C6H4PPh2)2] | 116248-83-0 | C36H28P2Pt |
| —— | p-chlorophenyl-β-cyanoethylphosphoric acid cyclohexylammonium salt | 78272-50-1 | C6H13N*C9H9ClNO4P |
| —— | p-Tolyl-ethaneperoxoic acid octahydro-naphthalen-4a-yl ester | 25258-40-6 | C19H26O3 |
| —— | Phenyliminophosphorsaeure-diaethylamid-dibutylamid-chlorid | 24002-56-0 | C18H33ClN3P |
| —— | Phosphoric acid (2R,3S,5R)-2-[(3-amino-phenoxy)-hydroxy-phosphoryloxymethyl]-5-(5-methyl-2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-yl)-tetrahydro-furan-3-yl ester 3-amino-phenyl ester | 35010-64-1 | C22H26N4O11P2 |
| —— | p-Carboxy-benzolthiolsulfonsaeure-ethylester | 22183-57-9 | C9H10O4S2 |
| —— | p-Picolinoylaminobenzoyl-DL-methionin | 26379-10-2 | C18H19N3O4S |
| —— | Paederosidic acid-methylester | 27088-46-6 | C19H26O11S |
| —— | Phenyltritylcarbinyl-p-brombenzoat | 31280-74-7 | C33H25BrO2 |
| —— | p-Aethylisobutylidenacetophenon | 21847-82-5 | C14H18O |
| —— | Pd(η(3)-1,1-Me2CCHCH2)(2,6-bis(methylthiomethyl)pyridine)(1+) | 211129-59-8 | C14H22NPdS2 |