中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
p-(5-Methoxysalicylidenamino)-benzoesaeurepentylester |
27722-37-8 |
C20H23NO4 |
|
—— |
piperidin-4-yl(o-tolyl)methanone hydrochloride |
64671-34-7 |
C13H17NO*ClH |
|
—— |
p-Octyloxybenzylidenpentafluoranilin |
63572-22-5 |
C21H22F5NO |
|
—— |
(piperidine-1-carboxylic acid )-(piperidine-1-carbothioic acid )-thioanhydride |
28786-75-6 |
C12H20N2OS2 |
|
—— |
[Pb(II)(2,2'-bipyridine)(nitrate)(acetate)]n |
866405-65-4 |
C2H3O2*C10H8N2*NO3*Pb |
|
—— |
p-Toluolsulfonylglyoxylsaeure-ethylester-<2-methoxy-5-nitro-phenylhydrazon> |
1528-90-1 |
C18H19N3O7S |
|
—— |
Phenyl(uridinato-N<sup>3</sup>)quecksilber |
72813-24-2 |
C15H16HgN2O6 |
|
—— |
p-TSA.H-(carba-4-Cl-Ff)-R(Pbf)W-OMe |
406953-41-1 |
C7H8O3S*C50H62ClN7O7S |
|
—— |
Phenyl-O-(2,3-di-O-benzyl-α-D-glucopyranosyl)-(1->4)-O-(2,3,6-tri-O-benzyl-α-D-glucopyranosyl)-(1->4)-2,3,6-tri-O-benzyl-α-D-glucopyranosid |
88773-17-5 |
C80H84O16 |
|
—— |
Phosphonothious acid, cyclohexyl-, O-ethyl S-phenyl ester |
62662-75-3 |
C14H21OPS |
|
—— |
Phenyl-o-phenylenthiophosphat |
108668-92-4 |
C12H9O3PS |
|
—— |
propargyl 3α-bromoacetoxy-12α-hydroxy-5β-cholan-24-oate |
1202459-78-6 |
C29H43BrO5 |
|
—— |
propionyl-phosphorous acid diethyl ester |
91997-19-2 |
C7H15O4P |
|
—— |
p-Toluolsulfonylglyoxylsaeure-aethylester-(4-chlor-o-tolylhydrazon) |
1528-94-5 |
C18H19ClN2O4S |
|
—— |
[PtH(C6H3(CH2P(iPr)2)2)] |
1004295-76-4 |
C20H36P2Pt |
|
—— |
Phthalic acid mono-(2-decanoylamino-ethyl) ester |
31384-18-6 |
C20H29NO5 |
|
—— |
Pentanoic acid [1-[6-(2-hydroxy-1-methyl-ethyl)-benzo[1,3]dioxol-5-yl]-1-(4-nitro-phenyl)-meth-(E)-ylidene]-hydrazide |
287378-97-6 |
C22H25N3O6 |
|
—— |
Perchlor-2-phenoxy-thiophen |
18613-05-3 |
C10H5Cl3OS |
|
—— |
Phosphoric acid (2R,3S,4R,5R)-5-(6-amino-purin-9-yl)-3,4-dihydroxy-tetrahydro-furan-2-ylmethyl ester (2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-tetrahydro-pyran-2-yl ester; compound with triethyl-amine |
141602-87-1 |
C6H15N*C16H24N5O11P |
|
—— |
Pyrido-<2.3-b>pyrazindicarbonsaeurediethylester-2.3 |
35252-06-3 |
C13H13N3O4 |
|
—— |
Protophan(6) n=5 |
35352-48-8 |
C51H62N6 |
|
—— |
[(Ph2PCH2-o-C6H4NMe2)Pd(C7H10COCH3)]O3SCF3 |
220925-88-2 |
CF3O3S*C30H35NOPPd |
|
—— |
p-hydroxymethylphenyl 2,3,4,6-tetra-O-acetyl-α-D-glucopyranoside |
64291-41-4 |
C21H26O11 |
|
—— |
p-methoxybenzoic acid-2-hexyl ester |
212260-94-1 |
C14H20O3 |
|
—— |
potassium B,B,B',B'-tetraethyl-μ-hydrido-{(Z)-1-ethyl-2-phenyl-1,2-ethendiyl}diborate |
143617-49-6 |
C18H31B2*K |
|
—— |
[Pb(5,5'-dimethyl-2,2'-bipyridine)(thenoyltrifluoroacetonate)2]2 |
1242145-79-4 |
C28H20F6N2O4PbS2 |
|
—— |
pneumocandin E0 |
258510-42-8 |
C50H80N8O16 |
|
—— |
{PPh4}{Cd(S-2,4,6-i-Pr3C6H2)3}*DMF*i-PrOH |
124511-87-1 |
C3H7NO*C3H8O*C24H20P*C45H69CdS |
|
—— |
Pivalinsaeure-(3-tert-butyl-4,5-dihydro-2-furanylester) |
127915-06-4 |
C13H22O3 |
|
—— |
[(Ph2PCH2CH2NHC(S)NHPh)Rh(1,5-cyclooctadiene)]Cl |
261177-68-8 |
C29H33N2PRhS*Cl |
|
—— |
Phosphoric acid (2R,3R,4R,5R)-4-(tert-butyl-dimethyl-silanyloxy)-5-(2-isobutyrylamino-6-oxo-1,6-dihydro-purin-9-yl)-2-[(4-methoxy-phenyl)-diphenyl-methoxymethyl]-tetrahydro-furan-3-yl ester 2-chloro-phenyl ester 2-cyano-ethyl ester |
79536-97-3 |
C49H56ClN6O10PSi |
|
—— |
(P(Fe))-(-)-[Fe((aS)-(-)-bis(5-methylylpyridine-2-carboxaldehyde 2'-pyridylhydrazone) 3,3,3',3'-tetramethyl-bis-1,1'-spiroindane-6,6'-dicarboxylate(2-))] |
1070971-31-1 |
C47H42FeN8O4 |
|
—— |
Phenyl-2-styryl-4-β-naphthyl-6-methyl-3-pyridin |
31380-22-0 |
C30H23N |
|
—— |
phenyl-(2-piperidin-1-ylmethyl-phenyl)-methanol |
94913-60-7 |
C19H23NO |
|
—— |
Propan-2-olate;1-[2-(pyridin-2-ylmethylideneamino)naphthalen-1-yl]naphthalen-2-olate;titanium(4+) |
1444240-77-0 |
C81H58N6O4Ti |
|
—— |
Phosphoric acid (2R,3S,5R)-5-(4-amino-2-oxo-2H-pyrimidin-1-yl)-2-hydroxymethyl-tetrahydro-furan-3-yl ester (2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-yl)-tetrahydro-furan-2-ylmethyl ester; compound with triethyl-amine |
87491-52-9 |
C6H15N*C19H26N5O11P |
|
—— |
[Pt(4'-(Ph)-2,2':6',2''-terpyridine)(CN)]BF4 |
925204-84-8 |
BF4*C22H15N4Pt |
|
—— |
Propyl 4-[[5-bromo-2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylamino]benzoate |
1263003-21-9 |
C23H24BrN3O5 |
|
—— |
potassium 2-(3-chloro-6-((2,2-difluoro-2-phenylethyl)amino)pyridin-2-yl)acetate |
950768-47-5 |
C15H12ClF2N2O2*K |
|
—— |
Phenyl 2-methylhex-5-ynoate |
138174-23-9 |
C13H14O2 |
|
—— |
p-CH3C5H4NBH3 |
3999-39-1 |
C6H10BN |
|
—— |
potassium hexacarbonyl vanadate (I) |
19624-42-1 |
C6O6V*K |
|
—— |
p-tolyl 2-O-acetyl-3,5-di-O-benzyl-1-thio-3-C-vinyl-α-L-lyxofuranoside |
1012859-24-3 |
C30H32O5S |
|
—— |
potassium;(2-acetamido-9H-fluoren-3-yl) sulfate |
109137-90-8 |
C15H12NO5S*K |
|
—— |
propyl 2-amino-4-methyl-5-phenylthiophene-3-carboxylate |
1213791-76-4 |
C15H17NO2S |
|
—— |
PhthN-D-OVal-OAcc-OMe |
1235496-87-3 |
C18H20N2O7 |
|
—— |
(p-tolylaminodiphenylphosphine)pentacarbonylmolybdenum(0) |
88922-17-2 |
C24H18MoNO5P |
|
—— |
Ph2P(S)CH2PPh2NP(S)(OPh)2 |
1020202-51-0 |
C37H32NO2P3S2 |
|
—— |
Piv-DL-Met-NHi-Pr |
117469-16-6 |
C13H26N2O2S |
|
—— |
[Pt(Me)(PPh2CH2CBu(t)=NN=CBu(t)CH2PPh2)]picrate |
160260-34-4 |
C6H2N3O7*C37H45N2P2Pt |
|