中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
p-methoxyphenyl 3,6-di-O-benzyl-2-deoxy-2-phthalimido-4-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-β-D-glucopyranoside |
211423-01-7 |
C49H51NO17 |
|
—— |
Propionylderivat. of 1-(2-ureidoethyl)-6-ureido-benzimidazole |
72550-48-2 |
C17H22N6O4 |
|
—— |
P,P-Di-p-chlorphenylphosphinsaeure-picrylhydrazid |
51764-24-0 |
C18H12Cl2N5O7P |
|
—— |
phenylmethyl<R-(R*,R*)>-1-(1-carboxycyclohexyl)-4-(1H-indol-3-ylmethyl)-2,5-dioxo-8-phenyl-1,3,6,9-tetraazadecan-10-oate |
144876-77-7 |
C35H39N5O6 |
|
—— |
Phenethyl(bismethylthio)methylketon |
38499-84-2 |
C12H16OS2 |
|
—— |
(p-acetylphenyl)cyclohexylacetylene |
1224169-12-3 |
C16H18O |
|
—— |
Pd((1-((2-benzylamino)ethylimino)methyl)naphthalene-2-ol)(Me) |
1380495-18-0 |
C21H22N2OPd |
|
—— |
p-toluenesulphonic-Z-glycinic anhydride |
98397-14-9 |
C17H17NO6S |
|
—— |
Propionic acid 1-methyl-4-(2-oxo-butyl)-piperidin-4-yl ester; compound with 3-carboxy-3-hydroxy-pentanedioic acid |
1563-31-1 |
C6H8O7*C13H23NO3 |
|
—— |
pentacarbonyl[5-tert-butyl-2,2-dimethyl-4-propyl-2H-pyrrole-N]tungsten |
952595-21-0 |
C18H23NO5W |
|
—— |
Pentanoic acid (1-cyclopropyl-vinyl)-(2-vinyloxy-ethyl)-amide |
129159-40-6 |
C14H23NO2 |
|
—— |
propyl-2 phenyl-1 cyclopentanecarbonitrile-1 r trans |
121926-32-7 |
C15H19N |
|
—— |
propan-2-one (4-phenyl-selenazol-2-yl)-hydrazone, hydrochloride |
108486-95-9 |
C12H13N3Se*ClH |
|
—— |
Pt(dippe)(SC12H8) |
210758-52-4 |
C26H40P2PtS |
|
—— |
[Pt(CH3)(H2O)(2,9-dimethyl-1,10-phenanthroline)(dimethyl maleate)]BF4 BF4(1-)*C21H25N2O5Pt(1+), yellow |
180396-28-5 |
BF4*C21H25N2O5Pt |
|
—— |
Pentacyclo<6.5.0.0<sup>4,12</sup>.0<sup>5,10</sup>.0<sup>9,13</sup>>tridecan-11-one dimethyl ketal |
132674-06-7 |
C15H22O2 |
|
—— |
phenyl 2,3,4,6-tetra-O-benzyl-α-D-glucopyranosyl-(1->4)-2-O-acetyl-3,6-di-O-benzyl-1-thio-β-D-glucopyranoside |
299174-91-7 |
C62H64O11S |
|
—— |
(p-Tolylthiomethyl)-triphenylgermanium |
54848-90-7 |
C26H24GeS |
|
—— |
phenyl 1,4-dizincbromide |
301300-52-7 |
C6H4Br2Zn2 |
|
—— |
pyrimido[1,2-b]pyrrolo[1,2-d][1,2,4]triazin-5-ium 4-toluenesulfonate |
1600527-57-8 |
C7H7O3S*C9H7N4 |
|
—— |
phenylantimony(III) bis(5-methoxy-6-bromoisatin) |
152582-22-4 |
C24H15Br2N2O6Sb |
|
—— |
Phenyl-O-<2,3,6-tri-O-benzyl-4-O-(5-nitropyridin-2-yl)-α-D-glucopyranosyl>-(1->4)-2,3,6-tri-O-benzyl-α-D-glucopyranosid |
87591-30-8 |
C65H64N2O13 |
|
—— |
Phosphoric acid (2R,3S,5R)-5-(6-benzoylamino-purin-9-yl)-3-hydroxy-tetrahydro-furan-2-ylmethyl ester (2R,3S,5R)-2-[bis-(4-methoxy-phenyl)-phenyl-methoxymethyl]-5-(5-methyl-2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-yl)-tetrahydro-furan-3-yl ester methyl ester |
82739-93-3 |
C49H50N7O13P |
|
—— |
p-(2-Guanidinoethyl)phenoxyacetyl-L-aspartyl-amido-cyclohexan-1-carboxylic acid |
154162-78-4 |
C22H31N5O7 |
|
—— |
Phenyl-thioacetic acid [1-phenyl-eth-(Z)-ylidene]-hydrazide |
90057-52-6 |
C16H16N2S |
|
—— |
Phosphoric acid (E)-2-bromo-1-(2,4,6-trichloro-phenyl)-vinyl ester ethyl ester isopropyl ester |
52030-66-7 |
C13H15BrCl3O4P |
|
—— |
Phenethyl-(1-phenyl-cyclopropylmethyl)-amine |
35279-04-0 |
C18H21N |
|
—— |
[Pd(Fmes)2(pte)] |
801319-71-1 |
C32H18F18PdS2 |
|
—— |
Potassium butoxyethoxypropionate |
68311-20-6 |
C9H17KO4 |
|
—— |
Phosphostim Sodium |
259793-78-7 |
C5H10BrNa3O8P2 |
|
—— |
propyl (Z)-2-hydroxypentadec-9-enoate |
77899-00-4 |
C18H34O3 |
|
—— |
Pentanedioic acid, 2,4-bis(1,1-dimethylethyl)-, (R*,S*)- |
61575-94-8 |
C13H24O4 |
|
—— |
Phosphoric acid (4'S,5'R)-2-ethyl-2',2'-dimethyl-[2,4']bi[[1,3]dioxolanyl]-5'-ylmethyl ester diphenyl ester |
798554-59-3 |
C23H29O8P |
|
—— |
phosphoric acid mono-((1R,3R)-1-amino-3-(4-((R)-1-methyl-2-phenoxy-ethoxy)-phenyl)-cyclopentylmethyl) ester |
1036389-96-4 |
C21H28NO6P |
|
—— |
[(Pd[5-(COH)C6H3C(H)=NCy-C2,N](Cl))2(μ-1-diphenylphosphino-2-diphenylarsinoethane)] |
521070-14-4 |
C54H56AsCl2N2O2PPd2 |
|
—— |
[Pd(2-(4-imidazolyl)-ethylimino-6-methylpyridine)Cl]Cl * H2O |
197177-26-7 |
C12H14ClN4Pd*Cl*H2O |
|
—— |
pyridine-dibromoborane |
72541-88-9 |
C5H6BBr2N |
|
—— |
[PtCl4(3,4,7,8-tetramethyl-1,10-phenanthroline)] |
60595-77-9 |
C16H16Cl4N2Pt |
|
—— |
Pt(2,9-dimethyl-1,10-phenanthroline)(β-bromopropyl)Br3 |
244207-41-8 |
C17H18Br4N2Pt |
|
—— |
phenyl 3,4,6-tri-O-methyl-2-deoxy-1-thio-β-D-arabino-hexopyranoside |
104017-20-1 |
C15H22O4S |
|
—— |
phenyl-bis(triphenylgermoxy)stibane |
169828-87-9 |
C42H35Ge2O2Sb |
|
—— |
Ph(3-Cl)(5-OCF3)-(R)CH(OH)C(O)OH |
433938-49-9 |
C9H6ClF3O4 |
|
—— |
Phe-Ala-Leu-OBn*TFA |
1207718-89-5 |
C2HF3O2*C25H33N3O4 |
|
—— |
(+/-)-phthalic acid mono-(2,4'-dimethyl-benzhydryl ester) |
856806-17-2 |
C23H20O4 |
|
—— |
perfluoro(1-methylethane)sulfenomorpholide |
74494-37-4 |
C7H8F7NOS |
|
—— |
phenyl 2-O-benzyl-3,4-O-(2',3'-dimethoxybutane-2',3'-diyl)-1-thio-α-D-mannopyranoside |
1060735-24-1 |
C25H32O7S |
|
—— |
Phthalaldehydsaeure-3-ethoxybenzoylhydrazon |
33630-64-7 |
C17H16N2O4 |
|
—— |
Phosphoric acid (E)-2-bromo-1-(2,4-dichloro-phenyl)-vinyl ester methyl ester propyl ester |
51963-20-3 |
C12H14BrCl2O4P |
|
—— |
p-Nitro-phenyl-glyoxyl-N-p-nitro-phenylhydrazonsaeurechlorid |
80943-96-0 |
C14H9ClN4O5 |
|
—— |
[Pd((η(2)-CH2CHSiMe2)2O)P(2-MeC6H4)3] |
252008-10-9 |
C29H39OPPdSi2 |
|