Oxidative Addition across Sb–H and Sb–Sb Bonds by an Osmium Carbonyl Cluster: Trapping the Intermediate
摘要:
The cluster Os-3(CO)(11)(NCCH3) oxidatively adds across the Sb-H bond in SbPh2H to afford the clusters Os-3(CO)(11)(H)(mu-SbPh2) and Os-3(CO)(11)(mu-H)(mu-SbPh2)Os-3(CO)(11). Similarly, its reaction with Sb2Ph4 afforded Os-3(CO)(11)(mu-SbPh2)(2)Os-3(CO)(11) as the major product. In both cases, the intermediate from the oxidative addition reaction was trapped as a W(CO)(5) adduct.