A mixed Co- and Os-containingn,?-bicluster complex based on ?-phenylpropionitrile
摘要:
The PhCH(2)CH(2)CNOs(3)(CO)(11) complex was prepared by the reaction of OS3(CO)(12) with beta-cyanoethylbenzene, while the reaction with (CO)(3)CrPhCH(2)CH(2)CN gave a heterometallic derivative, (CO)(3)CrPhCH(2)CH(2)CNOs(3)(CO)(11). A bicluster complex, Co-4(CO)(9)PhCH(2)CH(2)CNOs(3)(CO)(11), was synthesized for the first time by the reaction of PhCH(2)CH(2)CNOs(3)(CO)(11) with Co-2(CO)(8); Co-4(CO)(9)PhCH(2)CH(2)CN was also obtained.
A mixed Co- and Os-containingn,?-bicluster complex based on ?-phenylpropionitrile
摘要:
The PhCH(2)CH(2)CNOs(3)(CO)(11) complex was prepared by the reaction of OS3(CO)(12) with beta-cyanoethylbenzene, while the reaction with (CO)(3)CrPhCH(2)CH(2)CN gave a heterometallic derivative, (CO)(3)CrPhCH(2)CH(2)CNOs(3)(CO)(11). A bicluster complex, Co-4(CO)(9)PhCH(2)CH(2)CNOs(3)(CO)(11), was synthesized for the first time by the reaction of PhCH(2)CH(2)CNOs(3)(CO)(11) with Co-2(CO)(8); Co-4(CO)(9)PhCH(2)CH(2)CN was also obtained.