Reaction of lanthanide(II) and lanthanide(III) phenylethynyl cuprates with acetyl chloride
摘要:
Praseodymium and ytterbium phenylethynyl cuprates [(PhC C)(3)Cu](3)Pr(2)(THF)(6) and {[(PhC= C)(3)Cu]center dot Yb(THF)(2)}(2) react with acetyl chloride in tetrahydrofuran with elimination of phenylethynylcopper and formation of alkoxides [PhC C-CCl(CH(3))O](n)Ln (n = 3, Ln = Pr; n = 2, Ln = Yb). Then praseodymium alkoxide forms ester [methyl (phenylethynyl)chloromethylethanoate] and praseodymium chloride, alkoxy derivative. Itterbium alkoxide is oxidized to unsymmetrical dialkoxyitterbium chloride PhC C-CH(CH(3))-O-Yb(Cl)-O-CCl(CH(3))C CPh center dot 2THF.