Photochemical Reaction of CpFe(CO)2SiMe3 (Cp = η5-C5H5) with a Trihydrosilane Containing a Bulky Amino Substituent, Bis(trimethylsilyl)aminosilane
摘要:
A photochemical reaction between CpFe(CO)(2)SiMe3 and (Me3Si)(2)NSiH3 in hexane gave the silylyne-bridged triiron complex Cp3Fe3(CO)(4)SiN(SiMe3)(2) (2) and a diiron complex bridged by a four-membered cyclic silylene, Cp2Fe2(CO)(2)(mu-CO)(mu-SiN(SiMe3)(2)SiMe2CH2) (3). In contrast, the silylene- and alkyne-bridged triiron complex Cp3Fe3{mu(2)-SiHN(SiMe3)(2)}{mu(3)-COSiH2N(SiMe3)(2)}{mu(3)-eta(2)-C2O2-SiHN(SiMe3)(2)} (4) was formed as the main product by a similar reaction in toluene.