中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
Acetic acid (Z)-1-methyl-3,5-bis-methylsulfanyl-pent-4-enyl ester |
31849-95-3 |
C10H18O2S2 |
|
—— |
|
14614-36-9 |
C54H63ClN8O10 |
|
—— |
3,4-Dimethyl-5-oxo-1,2-pentamethylen-imidazolidin |
10188-26-8 |
C10H18N2O |
|
—— |
(S)-4-benzyloxy-2-[4-(3,4-dichloro-phenyl)-7-oxo-[1,4]diazepan-1-yl]-butyric acid methyl ester |
1206599-60-1 |
C23H26Cl2N2O4 |
|
—— |
Tris-(2,6-dimethoxyphenyl)-phosphat |
3820-70-0 |
C24H27O10P |
|
—— |
(S)-3-(4-tert-Butoxy-phenyl)-2-(1,1-dimethyl-propoxycarbonylamino)-propionic acid |
37579-50-3 |
C19H29NO5 |
|
—— |
(2E,4E)-5-(2-Acetoxy-6-methyl-phenyl)-3-methyl-penta-2,4-dienoic acid ethyl ester |
41435-96-5 |
C17H20O4 |
|
—— |
(2-Dimethylamino-3-methoxycarbonylmethyldisulfanyl-propyldisulfanyl)-acetic acid methyl ester; compound with oxalic acid |
56823-39-3 |
C2H2O4*C11H21NO4S4 |
|
—— |
Methyl L-2-(1,2:5,6-Di-O-isopropyliden-α-D-galactofuranos-3-yl)-glycinat |
43216-57-5 |
C15H25NO8 |
|
—— |
2-(2-Hydroxy-phenylazo)-cyclopent-1-enecarboxylic acid methyl ester |
53639-62-6 |
C13H14N2O3 |
|
—— |
|
1126078-78-1 |
C27H34N4O4 |
|
—— |
|
944446-82-6 |
C14H24N2O9 |
|
—— |
N-Benzyloxycarbonyl-Gly-Gly-Gly-(α,α-D2)Gly-(α,α-D2)Gly-Tyr |
23234-55-1 |
C27H32N6O10 |
|
—— |
methyl (2S)-2-amino-4-oxo-4-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]-2-(trifluoromethyl)butanoate |
208192-93-2 |
C20H27F3N2O12 |
|
—— |
(S)-2-Ethylsulfanylthiocarbonylamino-4-methyl-pentanoic acid |
37527-05-2 |
C9H17NO2S2 |
|
—— |
2-(1-ethoxyethylidene)-5,5-dimethylcyclohexane-1,3-dione |
1441071-41-5 |
C12H18O3 |
|
—— |
|
51806-93-0 |
C25H31N7O5 |
|
—— |
Trichloro-acetic acid (2R,3R,4S,5R)-4,5-diacetoxy-2-chloro-tetrahydro-pyran-3-yl ester |
51295-65-9 |
C11H12Cl4O7 |
|
—— |
Boc-Thr(CH2Ph)-Ser(CH2Ph)-Cys(CH2-C6H4-OCH3-p)-OCH2Ph |
43176-93-8 |
C44H53N3O9S |
|
—— |
Methyl-thiophosphoramidic acid O,O'-bis-(5,5-dimethyl-2-thioxo-2λ<sup>5</sup>-[1,3,2]dioxaphosphinan-2-yl) ester |
61614-91-3 |
C11H24NO6P3S3 |
|
—— |
Boc-Tyr(Bzl)-Chg-His(Dnp)-Pro-Lac-OBzl |
109183-76-8 |
C56H64N8O14 |
|
—— |
(5-Isopropyl-2-methyl-cyclohex-1-enyl)-acetic acid ethyl ester |
54280-99-8 |
C14H24O2 |
|
—— |
{2-[4-(Ethoxycarbonylmethyl-sulfamoyl)-phenyl]-1,3-dioxo-indan-2-ylamino}-acetic acid ethyl ester |
42557-55-1 |
C23H24N2O8S |
|
—— |
2-Hexyloxycarbonylmethylsulfanyl-succinic acid dimethyl ester |
33038-89-0 |
C14H24O6S |
|
—— |
|
23575-66-8 |
C8H15Cl2O2P |
|
—— |
Dimethyl-thiophosphoramidic acid O-(3-chloro-phenyl) ester; compound with trimethyl-amine |
37771-80-5 |
C3H9N*C8H11ClNO2PS |
|
—— |
t-butyl-carbamoyl-lithium |
33358-14-4 |
C5H10LiNO |
|
—— |
|
225121-03-9 |
C23H31N5O2 |
|
—— |
|
225121-00-6 |
C19H15Cl4N3O2 |
|
—— |
|
225120-81-0 |
C20H19Cl2N3O2 |
|
—— |
4-Cyano-2-(2-cyano-1-methyl-ethyl)-2-formylamino-3-methyl-butyric acid ethyl ester |
38067-39-9 |
C13H19N3O3 |
|
—— |
2-diethoxythiophosphoryloxy-5-methyl-pyrazolo[1,5-<i>a</i>]pyrimidine-6-carboxylic acid dodecyl ester |
13457-20-0 |
C24H40N3O5PS |
|
—— |
|
67587-48-8 |
C12H19NOS2 |
|
—— |
Boc-Glu(OBzl)-D-Phe-Lys(Z)-OMe |
128633-30-7 |
C41H52N4O10 |
|
—— |
N-methoxy-N-methyl-2-(2,2,6,6-tetramethyl-piperidin-1-yloxy)-malonamic acid methyl ester |
853886-55-2 |
C15H28N2O5 |
|
—— |
|
670233-32-6 |
C20H25BrN2O6 |
|
—— |
N-Benzyloxycarbonyl-O-chlorformyl-DL-serin-methylester |
27748-61-4 |
C13H14ClNO6 |
|
—— |
1-(2'-Benzylsulfonylphenyl)pyrrolidin-5-on-2-carbonsaeureethylester |
39231-71-5 |
C20H21NO5S |
|
—— |
dithiophosphoric acid <i>S</i>-ethyl ester <i>O</i>,<i>O</i>'-di-prop-2-ynyl ester |
26842-92-2 |
C8H11O2PS2 |
|
—— |
2-fluoro-3,5-dimethyl-[1,3,2]oxazaphospholidine 2-oxide |
37893-06-4 |
C4H9FNO2P |
|
—— |
<i>N</i>-(4-iodo-benzenesulfonyl)-β-alanine <i>N</i>'-benzoyl-hydrazide |
38378-15-3 |
C16H16IN3O4S |
|
—— |
N-(8-Chloro-oct-2-ynyl)-acetamide |
32769-60-1 |
C10H16ClNO |
|
—— |
Formic acid 1,3,5,5-tetramethyl-hexyl ester |
71621-69-7 |
C11H22O2 |
|
—— |
<i>N</i>-methyl-<i>N</i>-(1-methyl-prop-2-ynyl)-glycine 4-(6-oxo-1,4,5,6-tetrahydro-pyridazin-3-yl)-anilide |
39754-22-8 |
C17H20N4O2 |
|
—— |
thiophosphoric acid <i>O</i>-(5-chloro-2-ethyl-2<i>H</i>-pyrazol-3-yl) ester <i>O'</i>,<i>O''</i>-dimethyl ester |
71756-17-7 |
C7H12ClN2O3PS |
|
—— |
diethyl ketone enol propionate |
83710-42-3 |
C8H14O2 |
|
—— |
2,2-Dimethyl-propionic acid 5-iodo-1-methyl-pentyl ester |
82131-12-2 |
C11H21IO2 |
|
—— |
|
1245522-24-0 |
C24H32N2O3 |
|
—— |
2-azepan-1-yl-<i>N</i>-[4-(6-oxo-1,4,5,6-tetrahydro-pyridazin-3-yl)-phenyl]-acetamide |
39754-26-2 |
C18H24N4O2 |
|
—— |
1-(4-Amino-benzenesulfonyl)-5-oxo-pyrrolidine-2-carboxylic acid amide |
91332-81-9 |
C11H13N3O4S |
|