中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
N-<2-Methyl-5,7-dinitro-benzimidazolyl-(4)>-L-ala-gly |
18646-00-9 |
C13H14N6O7 |
|
—— |
Z-Tyr(CH2Ph)-Ile-Glu(NH2)-Asp(NH2)-Cys(CH2Ph)-ONB |
34027-21-9 |
C56H64N8O13S |
|
—— |
(2S)-1,8-Diacetyl-3a-acetoxy-1,2,3,3a,8,8a-hexahydro-pyrrolo<2,3-b>indol-2-carbonsaeureethylester |
21018-92-8 |
C19H22N2O6 |
|
—— |
5-Methyl-bicyclo[2.1.0]pentane-5-carboxylic acid ethyl ester |
23201-51-6 |
C9H14O2 |
|
—— |
|
25647-43-2 |
C11H13NO4 |
|
—— |
Ac-Pro-Phe(CH3)-His((CH3)2)-Leu(CH3)-Leu(CH3)-Val(CH3)-Tyr((CH3)2)-Ser((CH3)3) |
35897-33-7 |
C62H94N10O12 |
|
—— |
N,N'-dihydroxy-N,N'-dimethyl-2,2'-(1,14-diaza-cyclohexacosane-1,14-diyl)-bis-acetamide |
71672-31-6 |
C30H60N4O4 |
|
—— |
3-Methyl-2-oxo-5,7-dinitro-1,2,3,4-tetrahydro-chinoxalin |
18646-06-5 |
C9H8N4O5 |
|
—— |
N,N'-Bis-<1-oxyl-2,2,5,5-tetramethyl-pyrrolin-3-carboxy>-ethylendiamin-N,N'-diessigsaeure-Biradikal |
29212-00-8 |
C24H36N4O8 |
|
—— |
N,N'-Decamethylenbis(S-2-aminoethyl-hydrogen-thiosulfat) |
35871-52-4 |
C14H32N2O6S4 |
|
—— |
|
41501-52-4 |
C23H22N2O5 |
|
—— |
7-[2-(4-Hydroxy-phenyl)-2-((Z)-3-methoxycarbonyl-allylamino)-acetylamino]-3-methyl-8-oxo-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid tert-butyl ester |
64968-69-0 |
C25H31N3O7S |
|
—— |
3R-(2,2-Dimethyl-1S-(3-methoxyphenyl)carbamoyl-propylcarbamoyl)-2S-hydroxy-5-methylhexanohydroxamic acid |
171763-68-1 |
C21H33N3O6 |
|
—— |
|
1245510-46-6 |
C23H26N4O2 |
|
—— |
4-(Cyclopropylamino)-2-[4-[[2-(dimethylamino)-2-oxoethyl]amino]anilino]pyrimidine-5-carboxamide |
1198305-30-4 |
C18H23N7O2 |
|
—— |
ethyl endo-7-chlorobicyclo[4.1.0]heptane-7-carboxylate |
1091681-81-0 |
C10H15ClO2 |
|
—— |
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1R,2R)-2-(dimethylamino)cyclohexyl]carbamothioylamino]oxan-2-yl]methyl acetate |
1023695-17-1 |
C23H37N3O9S |
|
—— |
N-[N-(4-morpholinylcarbonyl)-L-leucyl]-L-norleucinol |
944281-96-3 |
C17H33N3O4 |
|
—— |
1-acetyl-3-oxo-1,2,3,4-tetrahydro-quinoxaline-2-carboxylic acid 6-methyl-pyridin-2-ylamide |
36818-17-4 |
C17H16N4O3 |
|
—— |
2-(deca-<i>O</i>-acetyl-<i>lin</i>-tri[1β->4]-<i>D</i>-glucopyranosyl)-2<i>H</i>-[1,2,4]triazine-3,5-dione |
39020-67-2 |
C41H53N3O27 |
|
—— |
2-(9-Methyl-9H-fluoren-9-yloxycarbonylamino)-pentanedioic acid 5-benzyl ester |
47739-82-2 |
C27H25NO6 |
|
—— |
|
1000605-65-1 |
C31H44N2O4Si |
|
—— |
1-[(2,6-Dimethyl-phenylcarbamoyl)-methyl]-piperidine-4-carboxylic acid diethylamide |
4343-84-4 |
C20H31N3O2 |
|
—— |
Acetic acid (Z)-1-methyl-3,5-bis-methylsulfanyl-pent-4-enyl ester |
31849-95-3 |
C10H18O2S2 |
|
—— |
|
14614-36-9 |
C54H63ClN8O10 |
|
—— |
3,4-Dimethyl-5-oxo-1,2-pentamethylen-imidazolidin |
10188-26-8 |
C10H18N2O |
|
—— |
(S)-4-benzyloxy-2-[4-(3,4-dichloro-phenyl)-7-oxo-[1,4]diazepan-1-yl]-butyric acid methyl ester |
1206599-60-1 |
C23H26Cl2N2O4 |
|
—— |
Tris-(2,6-dimethoxyphenyl)-phosphat |
3820-70-0 |
C24H27O10P |
|
—— |
(S)-3-(4-tert-Butoxy-phenyl)-2-(1,1-dimethyl-propoxycarbonylamino)-propionic acid |
37579-50-3 |
C19H29NO5 |
|
—— |
(2E,4E)-5-(2-Acetoxy-6-methyl-phenyl)-3-methyl-penta-2,4-dienoic acid ethyl ester |
41435-96-5 |
C17H20O4 |
|
—— |
(2-Dimethylamino-3-methoxycarbonylmethyldisulfanyl-propyldisulfanyl)-acetic acid methyl ester; compound with oxalic acid |
56823-39-3 |
C2H2O4*C11H21NO4S4 |
|
—— |
Methyl L-2-(1,2:5,6-Di-O-isopropyliden-α-D-galactofuranos-3-yl)-glycinat |
43216-57-5 |
C15H25NO8 |
|
—— |
2-(2-Hydroxy-phenylazo)-cyclopent-1-enecarboxylic acid methyl ester |
53639-62-6 |
C13H14N2O3 |
|
—— |
|
1126078-78-1 |
C27H34N4O4 |
|
—— |
|
944446-82-6 |
C14H24N2O9 |
|
—— |
N-Benzyloxycarbonyl-Gly-Gly-Gly-(α,α-D2)Gly-(α,α-D2)Gly-Tyr |
23234-55-1 |
C27H32N6O10 |
|
—— |
methyl (2S)-2-amino-4-oxo-4-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]-2-(trifluoromethyl)butanoate |
208192-93-2 |
C20H27F3N2O12 |
|
—— |
(S)-2-Ethylsulfanylthiocarbonylamino-4-methyl-pentanoic acid |
37527-05-2 |
C9H17NO2S2 |
|
—— |
2-(1-ethoxyethylidene)-5,5-dimethylcyclohexane-1,3-dione |
1441071-41-5 |
C12H18O3 |
|
—— |
|
51806-93-0 |
C25H31N7O5 |
|
—— |
Trichloro-acetic acid (2R,3R,4S,5R)-4,5-diacetoxy-2-chloro-tetrahydro-pyran-3-yl ester |
51295-65-9 |
C11H12Cl4O7 |
|
—— |
Boc-Thr(CH2Ph)-Ser(CH2Ph)-Cys(CH2-C6H4-OCH3-p)-OCH2Ph |
43176-93-8 |
C44H53N3O9S |
|
—— |
Methyl-thiophosphoramidic acid O,O'-bis-(5,5-dimethyl-2-thioxo-2λ<sup>5</sup>-[1,3,2]dioxaphosphinan-2-yl) ester |
61614-91-3 |
C11H24NO6P3S3 |
|
—— |
Boc-Tyr(Bzl)-Chg-His(Dnp)-Pro-Lac-OBzl |
109183-76-8 |
C56H64N8O14 |
|
—— |
(5-Isopropyl-2-methyl-cyclohex-1-enyl)-acetic acid ethyl ester |
54280-99-8 |
C14H24O2 |
|
—— |
{2-[4-(Ethoxycarbonylmethyl-sulfamoyl)-phenyl]-1,3-dioxo-indan-2-ylamino}-acetic acid ethyl ester |
42557-55-1 |
C23H24N2O8S |
|
—— |
2-Hexyloxycarbonylmethylsulfanyl-succinic acid dimethyl ester |
33038-89-0 |
C14H24O6S |
|
—— |
|
23575-66-8 |
C8H15Cl2O2P |
|
—— |
Dimethyl-thiophosphoramidic acid O-(3-chloro-phenyl) ester; compound with trimethyl-amine |
37771-80-5 |
C3H9N*C8H11ClNO2PS |
|
—— |
t-butyl-carbamoyl-lithium |
33358-14-4 |
C5H10LiNO |
|