| 中文名称 | 英文名称 | CAS号 | 化学式 |
|---|---|---|---|
| —— | 3R-(2,2-Dimethyl-1S-(3-methoxyphenyl)carbamoyl-propylcarbamoyl)-2S-hydroxy-5-methylhexanohydroxamic acid | 171763-68-1 | C21H33N3O6 |
| —— | 1245510-46-6 | C23H26N4O2 | |
| —— | 4-(Cyclopropylamino)-2-[4-[[2-(dimethylamino)-2-oxoethyl]amino]anilino]pyrimidine-5-carboxamide | 1198305-30-4 | C18H23N7O2 |
| —— | ethyl endo-7-chlorobicyclo[4.1.0]heptane-7-carboxylate | 1091681-81-0 | C10H15ClO2 |
| —— | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1R,2R)-2-(dimethylamino)cyclohexyl]carbamothioylamino]oxan-2-yl]methyl acetate | 1023695-17-1 | C23H37N3O9S |
| —— | N-[N-(4-morpholinylcarbonyl)-L-leucyl]-L-norleucinol | 944281-96-3 | C17H33N3O4 |
| —— | 1-acetyl-3-oxo-1,2,3,4-tetrahydro-quinoxaline-2-carboxylic acid 6-methyl-pyridin-2-ylamide | 36818-17-4 | C17H16N4O3 |
| —— | 2-(deca-<i>O</i>-acetyl-<i>lin</i>-tri[1β->4]-<i>D</i>-glucopyranosyl)-2<i>H</i>-[1,2,4]triazine-3,5-dione | 39020-67-2 | C41H53N3O27 |
| —— | 2-(9-Methyl-9H-fluoren-9-yloxycarbonylamino)-pentanedioic acid 5-benzyl ester | 47739-82-2 | C27H25NO6 |
| —— | 1000605-65-1 | C31H44N2O4Si | |
| —— | 1-[(2,6-Dimethyl-phenylcarbamoyl)-methyl]-piperidine-4-carboxylic acid diethylamide | 4343-84-4 | C20H31N3O2 |
| —— | Acetic acid (Z)-1-methyl-3,5-bis-methylsulfanyl-pent-4-enyl ester | 31849-95-3 | C10H18O2S2 |
| —— | 14614-36-9 | C54H63ClN8O10 | |
| —— | 3,4-Dimethyl-5-oxo-1,2-pentamethylen-imidazolidin | 10188-26-8 | C10H18N2O |
| —— | (S)-4-benzyloxy-2-[4-(3,4-dichloro-phenyl)-7-oxo-[1,4]diazepan-1-yl]-butyric acid methyl ester | 1206599-60-1 | C23H26Cl2N2O4 |
| —— | Tris-(2,6-dimethoxyphenyl)-phosphat | 3820-70-0 | C24H27O10P |
| —— | (S)-3-(4-tert-Butoxy-phenyl)-2-(1,1-dimethyl-propoxycarbonylamino)-propionic acid | 37579-50-3 | C19H29NO5 |
| —— | (2E,4E)-5-(2-Acetoxy-6-methyl-phenyl)-3-methyl-penta-2,4-dienoic acid ethyl ester | 41435-96-5 | C17H20O4 |
| —— | (2-Dimethylamino-3-methoxycarbonylmethyldisulfanyl-propyldisulfanyl)-acetic acid methyl ester; compound with oxalic acid | 56823-39-3 | C2H2O4*C11H21NO4S4 |
| —— | Methyl L-2-(1,2:5,6-Di-O-isopropyliden-α-D-galactofuranos-3-yl)-glycinat | 43216-57-5 | C15H25NO8 |
| —— | 2-(2-Hydroxy-phenylazo)-cyclopent-1-enecarboxylic acid methyl ester | 53639-62-6 | C13H14N2O3 |
| —— | 1126078-78-1 | C27H34N4O4 | |
| —— | 944446-82-6 | C14H24N2O9 | |
| —— | N-Benzyloxycarbonyl-Gly-Gly-Gly-(α,α-D2)Gly-(α,α-D2)Gly-Tyr | 23234-55-1 | C27H32N6O10 |
| —— | methyl (2S)-2-amino-4-oxo-4-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]-2-(trifluoromethyl)butanoate | 208192-93-2 | C20H27F3N2O12 |
| —— | (S)-2-Ethylsulfanylthiocarbonylamino-4-methyl-pentanoic acid | 37527-05-2 | C9H17NO2S2 |
| —— | 2-(1-ethoxyethylidene)-5,5-dimethylcyclohexane-1,3-dione | 1441071-41-5 | C12H18O3 |
| —— | 51806-93-0 | C25H31N7O5 | |
| —— | Trichloro-acetic acid (2R,3R,4S,5R)-4,5-diacetoxy-2-chloro-tetrahydro-pyran-3-yl ester | 51295-65-9 | C11H12Cl4O7 |
| —— | Boc-Thr(CH2Ph)-Ser(CH2Ph)-Cys(CH2-C6H4-OCH3-p)-OCH2Ph | 43176-93-8 | C44H53N3O9S |
| —— | Methyl-thiophosphoramidic acid O,O'-bis-(5,5-dimethyl-2-thioxo-2λ<sup>5</sup>-[1,3,2]dioxaphosphinan-2-yl) ester | 61614-91-3 | C11H24NO6P3S3 |
| —— | Boc-Tyr(Bzl)-Chg-His(Dnp)-Pro-Lac-OBzl | 109183-76-8 | C56H64N8O14 |
| —— | (5-Isopropyl-2-methyl-cyclohex-1-enyl)-acetic acid ethyl ester | 54280-99-8 | C14H24O2 |
| —— | {2-[4-(Ethoxycarbonylmethyl-sulfamoyl)-phenyl]-1,3-dioxo-indan-2-ylamino}-acetic acid ethyl ester | 42557-55-1 | C23H24N2O8S |
| —— | 2-Hexyloxycarbonylmethylsulfanyl-succinic acid dimethyl ester | 33038-89-0 | C14H24O6S |
| —— | 23575-66-8 | C8H15Cl2O2P | |
| —— | Dimethyl-thiophosphoramidic acid O-(3-chloro-phenyl) ester; compound with trimethyl-amine | 37771-80-5 | C3H9N*C8H11ClNO2PS |
| —— | t-butyl-carbamoyl-lithium | 33358-14-4 | C5H10LiNO |
| —— | 225121-03-9 | C23H31N5O2 | |
| —— | 225121-00-6 | C19H15Cl4N3O2 | |
| —— | 225120-81-0 | C20H19Cl2N3O2 | |
| —— | 4-Cyano-2-(2-cyano-1-methyl-ethyl)-2-formylamino-3-methyl-butyric acid ethyl ester | 38067-39-9 | C13H19N3O3 |
| —— | 2-diethoxythiophosphoryloxy-5-methyl-pyrazolo[1,5-<i>a</i>]pyrimidine-6-carboxylic acid dodecyl ester | 13457-20-0 | C24H40N3O5PS |
| —— | 67587-48-8 | C12H19NOS2 | |
| —— | Boc-Glu(OBzl)-D-Phe-Lys(Z)-OMe | 128633-30-7 | C41H52N4O10 |
| —— | N-methoxy-N-methyl-2-(2,2,6,6-tetramethyl-piperidin-1-yloxy)-malonamic acid methyl ester | 853886-55-2 | C15H28N2O5 |
| —— | 670233-32-6 | C20H25BrN2O6 | |
| —— | N-Benzyloxycarbonyl-O-chlorformyl-DL-serin-methylester | 27748-61-4 | C13H14ClNO6 |
| —— | 1-(2'-Benzylsulfonylphenyl)pyrrolidin-5-on-2-carbonsaeureethylester | 39231-71-5 | C20H21NO5S |
| —— | dithiophosphoric acid <i>S</i>-ethyl ester <i>O</i>,<i>O</i>'-di-prop-2-ynyl ester | 26842-92-2 | C8H11O2PS2 |