中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
heptafluoro-tetrahydro-furan-2-carbonitrile |
65601-71-0 |
C5F7NO |
|
—— |
Hexadecylmethylpentylmethanol |
63067-56-1 |
C23H48O |
|
—— |
His-Ala-Phe-Ile-Gly-Leu-Met-NH2 |
14045-51-3 |
C37H58N10O7S |
|
—— |
hydroxy-diphenyl-acetaldehyde diphenylacetal |
860511-43-9 |
C26H22O3 |
|
—— |
Hexadecanoic acid 2-[(2-amino-2-carboxy-ethoxy)-hydroxy-phosphoryl]-1-hexadecanoyloxymethyl-ethyl ester |
64563-63-9 |
C38H74NO9P |
|
—— |
Hydrazon |
73981-92-7 |
C17H15N3O5 |
|
—— |
hexakis(dimethylboryl)benzene-bipyridine adduct |
285116-18-9 |
C28H46B6N2 |
|
—— |
(Hydroxy-phenyl-methyl)-phosphonic acid mono-(2-hydroxy-ethyl) ester; compound with trimethyl-amine |
67622-80-4 |
C3H9N*C9H13O5P |
|
—— |
H2N-AENITTH-MPA |
1127632-24-9 |
C35H56N10O14S |
|
—— |
Homomethioninol |
51229-86-8 |
C6H15NOS |
|
—— |
(-)-hapalindole G |
102045-13-6 |
C21H23ClN2 |
|
—— |
h-Ethyl (E)-3-(3-butoxy-4-iodophenyl)-2-methylacrylate |
935875-11-9 |
C16H21IO3 |
|
—— |
H-β<sup>2,2</sup>-HBip-β<sup>2,2</sup>-HBip-OMe |
272787-78-7 |
C35H34N2O3 |
|
—— |
Hexahydrolaurefucin |
52128-57-1 |
C15H27BrO3 |
|
—— |
H-(β-SH)DNPCYS-NH<sub>2</sub> |
1460214-14-5 |
C28H40N8O11S2 |
|
—— |
hydroxy-diphenyl-acetic acid 2-morpholin-4-yl-propyl ester |
54504-92-6 |
C21H25NO4 |
|
—— |
hydrogen peroxydiphosphate |
56795-74-5 |
HO8P2 |
|
—— |
Hexadecanoic acid (2,2,2-trichloro-1-imidazol-1-yl-ethyl)-amide |
56736-97-1 |
C21H36Cl3N3O |
|
—— |
hepta-4,5-dien-2-yn-1-ol |
3589-09-1 |
C7H8O |
|
—— |
heptamethyl-1,3,5,2,4,6-triazasiladiborine |
57604-50-9 |
C7H21B2N3Si |
|
—— |
hexa-tert-butyl 10,10'-(6-((2-((2-methoxy-2-oxoethyl)amino)-2-oxoethyl)amino)-1,3,5-triazine-2,4-diyl)bis(1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate) |
1241955-34-9 |
C54H95N13O15 |
|
—— |
H3B[C(PPh3)2] |
924708-17-8 |
C37H33BP2 |
|
—— |
hydrogen hexafluorovanadate(V) |
133895-32-6 |
F6V*H |
|
—— |
His-Ala-Glu-Gly-Thr-Phe-Thr-Ser-Asp-[2-amino-3-(biphenyl-4-yl)propanoyl]-Phe-NH2 |
1380449-20-6 |
C64H80N14O18 |
|
—— |
HBr*Cys(O2NH2)-Lys(H2Br)-O-CH2-CH2-NH2*HBr |
87053-65-4 |
3BrH*C11H25N5O5S |
|
—— |
H-Glu(OBzl)-Val-OBu<sup>t</sup> |
97251-08-6 |
C21H32N2O5 |
|
—— |
[Hg(diethyldithiocarbamate)2]2*C60 |
920493-50-1 |
C20H40Hg2N4S8*C60 |
|
—— |
hydroxy-[2-(4-methoxy-phenyl)-1-oxy-quinolin-3-yl]-acetic acid methyl ester |
68118-38-7 |
C19H17NO5 |
|
—— |
H-D-Glu(L-Trp-OCH2-CO-N(CH3)2)-OH |
1401719-42-3 |
C20H26N4O6 |
|
—— |
hexa-tert-butyl 10,10'-(6-(prop-2-ynylamino)-1,3,5-triazine-2,4-diyl)bis(1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate) |
1093785-69-3 |
C52H90N12O12 |
|
—— |
H-Ala-D-Val-Val-D-Val-(Trp-D-Leu)3-Trp-2-(t-butyl-diphenylsilyloxy)-ethylamide |
339542-07-3 |
C98H130N16O12Si |
|
—— |
H-Trp-Leu-Asp(O-t-Bu)-Phe-NH2 |
51987-61-2 |
C34H46N6O6 |
|
—— |
hexyl 5-methoxy-2-nitrobenzoate |
1246882-31-4 |
C14H19NO5 |
|
—— |
H-Val-N(Me)Val-OIle-Oallyl |
1393736-50-9 |
C20H36N2O5 |
|
—— |
Hexanoic acid {4-[4-(4-nitro-phenylazo)-naphthalen-1-ylazo]-naphthalen-1-yl}-amide |
57060-15-8 |
C32H28N6O3 |
|
—— |
hexyl idebenone carboxylate |
1218992-04-1 |
C25H40O6 |
|
—— |
hexakis(thiourea)tetrakis(iodocopper(I)) monohydrate |
1094209-88-7 |
C6H24Cu4I4N12S6*H2O |
|
—— |
[HC(PPh2)3Au3Cu(C2-1-cyclopentanolyl)3]CF3SO3 |
1448230-96-3 |
CF3O3S*C58H58Au3CuO3P3 |
|
—— |
H-(Aib)<sub>2</sub>-OEt |
334537-44-9 |
C10H20N2O3 |
|
—— |
Heptylamino-acetic acid ethyl ester |
91249-63-7 |
C11H23NO2 |
|
—— |
hexakis(6-bis(t-butyloxycarbonylmethyl)amino-6-deoxy-2,3-di-O-methyl)-αCD |
1227871-09-1 |
C120H210N6O48 |
|
—— |
hydrochloride salt of 5,6,7,8-tetrahydro-2-methyl-3-quinolinecarboxylic acid ethyl ester |
101681-56-5 |
C13H17NO2*ClH |
|
—— |
H-His-D-Trp-Ala-aza-(Nε-methoxyethyl)Lys-D-Phe-Lys-NH2 |
1615698-06-0 |
C43H63N13O7 |
|
—— |
Hexanamide,3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-N-methoxy-N,2,5-trimethyl-,(2S,3R)- |
630096-47-8 |
C16H35NO3Si |
|
—— |
hexa-N-ethyl-N,N'-(3,6-dioxa-octanediyl)-di-ammonium; diiodide |
133232-00-5 |
C18H42N2O2*2I |
|
—— |
H-Pro-Gly-OBut*HCOOH |
83280-11-9 |
CH2O2*C11H20N2O3 |
|
—— |
H- Lys-Pro-Lys-Nle-Lys-OH |
1607011-12-0 |
C29H56N8O6 |
|
—— |
HgCl2((2-thienyl)CH(4-NO2C6H4)NH(isopropyl))2 |
113929-52-5 |
C28H32Cl2HgN4O4S2 |
|
—— |
[Hydroxy-imino-(4-{3-[4-(1-methyl-1-phenylethyl)-phenoxymethyl]benzyloxy}phenyl)-methyl]-amine |
175076-79-6 |
C30H30N2O3 |
|
—— |
Hexanoic acid 1,1-dimethyl-2-oxo-propyl ester |
69708-44-7 |
C11H20O3 |
|