| 中文名称 | 英文名称 | CAS号 | 化学式 |
|---|---|---|---|
| —— | heptafluoro-tetrahydro-furan-2-carbonitrile | 65601-71-0 | C5F7NO |
| —— | Hexadecylmethylpentylmethanol | 63067-56-1 | C23H48O |
| —— | His-Ala-Phe-Ile-Gly-Leu-Met-NH2 | 14045-51-3 | C37H58N10O7S |
| —— | hydroxy-diphenyl-acetaldehyde diphenylacetal | 860511-43-9 | C26H22O3 |
| —— | Hexadecanoic acid 2-[(2-amino-2-carboxy-ethoxy)-hydroxy-phosphoryl]-1-hexadecanoyloxymethyl-ethyl ester | 64563-63-9 | C38H74NO9P |
| —— | Hydrazon | 73981-92-7 | C17H15N3O5 |
| —— | hexakis(dimethylboryl)benzene-bipyridine adduct | 285116-18-9 | C28H46B6N2 |
| —— | (Hydroxy-phenyl-methyl)-phosphonic acid mono-(2-hydroxy-ethyl) ester; compound with trimethyl-amine | 67622-80-4 | C3H9N*C9H13O5P |
| —— | H2N-AENITTH-MPA | 1127632-24-9 | C35H56N10O14S |
| —— | Homomethioninol | 51229-86-8 | C6H15NOS |
| —— | (-)-hapalindole G | 102045-13-6 | C21H23ClN2 |
| —— | h-Ethyl (E)-3-(3-butoxy-4-iodophenyl)-2-methylacrylate | 935875-11-9 | C16H21IO3 |
| —— | H-β<sup>2,2</sup>-HBip-β<sup>2,2</sup>-HBip-OMe | 272787-78-7 | C35H34N2O3 |
| —— | Hexahydrolaurefucin | 52128-57-1 | C15H27BrO3 |
| —— | H-(β-SH)DNPCYS-NH<sub>2</sub> | 1460214-14-5 | C28H40N8O11S2 |
| —— | hydroxy-diphenyl-acetic acid 2-morpholin-4-yl-propyl ester | 54504-92-6 | C21H25NO4 |
| —— | hydrogen peroxydiphosphate | 56795-74-5 | HO8P2 |
| —— | Hexadecanoic acid (2,2,2-trichloro-1-imidazol-1-yl-ethyl)-amide | 56736-97-1 | C21H36Cl3N3O |
| —— | hepta-4,5-dien-2-yn-1-ol | 3589-09-1 | C7H8O |
| —— | heptamethyl-1,3,5,2,4,6-triazasiladiborine | 57604-50-9 | C7H21B2N3Si |
| —— | hexa-tert-butyl 10,10'-(6-((2-((2-methoxy-2-oxoethyl)amino)-2-oxoethyl)amino)-1,3,5-triazine-2,4-diyl)bis(1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate) | 1241955-34-9 | C54H95N13O15 |
| —— | H3B[C(PPh3)2] | 924708-17-8 | C37H33BP2 |
| —— | hydrogen hexafluorovanadate(V) | 133895-32-6 | F6V*H |
| —— | His-Ala-Glu-Gly-Thr-Phe-Thr-Ser-Asp-[2-amino-3-(biphenyl-4-yl)propanoyl]-Phe-NH2 | 1380449-20-6 | C64H80N14O18 |
| —— | HBr*Cys(O2NH2)-Lys(H2Br)-O-CH2-CH2-NH2*HBr | 87053-65-4 | 3BrH*C11H25N5O5S |
| —— | H-Glu(OBzl)-Val-OBu<sup>t</sup> | 97251-08-6 | C21H32N2O5 |
| —— | [Hg(diethyldithiocarbamate)2]2*C60 | 920493-50-1 | C20H40Hg2N4S8*C60 |
| —— | hydroxy-[2-(4-methoxy-phenyl)-1-oxy-quinolin-3-yl]-acetic acid methyl ester | 68118-38-7 | C19H17NO5 |
| —— | H-D-Glu(L-Trp-OCH2-CO-N(CH3)2)-OH | 1401719-42-3 | C20H26N4O6 |
| —— | hexa-tert-butyl 10,10'-(6-(prop-2-ynylamino)-1,3,5-triazine-2,4-diyl)bis(1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate) | 1093785-69-3 | C52H90N12O12 |
| —— | H-Ala-D-Val-Val-D-Val-(Trp-D-Leu)3-Trp-2-(t-butyl-diphenylsilyloxy)-ethylamide | 339542-07-3 | C98H130N16O12Si |
| —— | H-Trp-Leu-Asp(O-t-Bu)-Phe-NH2 | 51987-61-2 | C34H46N6O6 |
| —— | hexyl 5-methoxy-2-nitrobenzoate | 1246882-31-4 | C14H19NO5 |
| —— | H-Val-N(Me)Val-OIle-Oallyl | 1393736-50-9 | C20H36N2O5 |
| —— | Hexanoic acid {4-[4-(4-nitro-phenylazo)-naphthalen-1-ylazo]-naphthalen-1-yl}-amide | 57060-15-8 | C32H28N6O3 |
| —— | hexyl idebenone carboxylate | 1218992-04-1 | C25H40O6 |
| —— | hexakis(thiourea)tetrakis(iodocopper(I)) monohydrate | 1094209-88-7 | C6H24Cu4I4N12S6*H2O |
| —— | [HC(PPh2)3Au3Cu(C2-1-cyclopentanolyl)3]CF3SO3 | 1448230-96-3 | CF3O3S*C58H58Au3CuO3P3 |
| —— | H-(Aib)<sub>2</sub>-OEt | 334537-44-9 | C10H20N2O3 |
| —— | Heptylamino-acetic acid ethyl ester | 91249-63-7 | C11H23NO2 |
| —— | hexakis(6-bis(t-butyloxycarbonylmethyl)amino-6-deoxy-2,3-di-O-methyl)-αCD | 1227871-09-1 | C120H210N6O48 |
| —— | hydrochloride salt of 5,6,7,8-tetrahydro-2-methyl-3-quinolinecarboxylic acid ethyl ester | 101681-56-5 | C13H17NO2*ClH |
| —— | H-His-D-Trp-Ala-aza-(Nε-methoxyethyl)Lys-D-Phe-Lys-NH2 | 1615698-06-0 | C43H63N13O7 |
| —— | Hexanamide,3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-N-methoxy-N,2,5-trimethyl-,(2S,3R)- | 630096-47-8 | C16H35NO3Si |
| —— | hexa-N-ethyl-N,N'-(3,6-dioxa-octanediyl)-di-ammonium; diiodide | 133232-00-5 | C18H42N2O2*2I |
| —— | H-Pro-Gly-OBut*HCOOH | 83280-11-9 | CH2O2*C11H20N2O3 |
| —— | H- Lys-Pro-Lys-Nle-Lys-OH | 1607011-12-0 | C29H56N8O6 |
| —— | HgCl2((2-thienyl)CH(4-NO2C6H4)NH(isopropyl))2 | 113929-52-5 | C28H32Cl2HgN4O4S2 |
| —— | [Hydroxy-imino-(4-{3-[4-(1-methyl-1-phenylethyl)-phenoxymethyl]benzyloxy}phenyl)-methyl]-amine | 175076-79-6 | C30H30N2O3 |
| —— | Hexanoic acid 1,1-dimethyl-2-oxo-propyl ester | 69708-44-7 | C11H20O3 |