中文名称 |
英文名称 |
CAS号 |
化学式 |
结构式图片 |
—— |
Carbamoylazanium;2-hydroxyethyl phosphate |
—— |
C4H15N4O7P |
|
—— |
Bis(2-hydroxyethyl)azanium;6-methylheptyl hydrogen phosphate |
—— |
C12H30NO6P |
|
—— |
Diazanium;2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl phosphate |
—— |
C20H49N2O9P |
|
—— |
Ethanol, 2,2'-[(2-hydroxyethyl)imino]bis-, 1,1'-bis(dihydrogen phosphate) |
68155-58-8 |
C6H17NO9P2 |
|
—— |
Phosphoric acid, mono(1-methylethyl) ester, ammonium salt (1:2) |
68444-17-7 |
C3H15N2O4P |
|
—— |
3,6,9,12,15-Pentaoxapentacosan-1-ol, dihydrogen phosphate, dipotassium salt |
68480-00-2 |
C20H41K2O9P |
|
—— |
2-Hydroxyethylazanium;6-methylheptyl hydrogen phosphate |
—— |
C10H26NO5P |
|
—— |
2-[2-[2-[2-(2-Decoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl phosphate;tris(2-hydroxyethyl)azanium |
—— |
C32H73N2O15P |
|
—— |
Phosphoric acid monoethyl ester; compound with triethyl-amine |
68318-37-6 |
C2H7O4P*2C6H15N |
|
—— |
[Azaniumyl(azaniumylidene)methyl]-cyano-(hydroxymethyl)azanium;phosphate |
68324-21-0 |
C3H9N4O5P |
|
—— |
Triethanolamine, diphosphate ester, tetra(triethanolamine) salt |
68155-59-9 |
C30H83N5O39P8 |
|
—— |
2-[2-Hydroxyethyl(octadec-9-enoyl)amino]ethyl dihydrogen phosphate |
68186-53-8 |
C22H44NO6P |
|
—— |
Dipentyl phosphate;morpholin-4-ium |
68213-75-2 |
C14H32NO5P |
|
—— |
[1,3-Dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;(4-nitrophenyl) phosphate |
—— |
C14H28N3O12P |
|
—— |
3,9-bis[3-bromo-2,2-bis(bromomethyl)propoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane 3,9-dioxide |
61090-89-9 |
C15H24Br6O8P2 |
|
—— |
Dipotassium 2-butoxyethyl phosphate |
68389-63-9 |
C6H13K2O5P |
|
—— |
Bis(9,10-dibromooctadecyl) hydrogen phosphate |
68298-31-7 |
C36H71Br4O4P |
|
—— |
2-Hydroxypropylazanium;octyl hydrogen phosphate |
68227-24-7 |
C11H28NO5P |
|
—— |
Calcium tetrakis(9,10-dibromooctadecyl)bis(phosphate) |
—— |
C72H140Br8CaO8P2 |
|
—— |
2-Propenoic acid, 2-(phosphonooxy)-, tripotassium salt |
60125-03-3 |
C3H2K3O6P |
|
—— |
Sodium eicosyl phosphate |
68186-38-9 |
C20H43NaO5P- |
|
—— |
2-Propenoicacid,2-(phosphonooxy)-,sodiumsalt(1:2) |
55340-66-4 |
C3H3Na2O6P |
|
—— |
tert-Butylphenyl diphenyl phosphate mixt. with triphenyl phosphate |
96300-96-8 |
C40H40O8P2 |
|
—— |
Phosphoric acid,2-ethylhexyl ester,compd. with 2,2,2-nitrilotris(ethanol) |
—— |
C20H49N2O10P |
|
—— |
1-Propylheptyl dihydrogen phosphate |
68110-00-9 |
C10H23O4P |
|
—— |
2-Octadecyl-1-(2-(carbamyloxy)ethyl)imidazolium, monoethylphosphate |
67815-94-5 |
C26H56N3O6P |
|
—— |
9,9-dimethyldecylazanium;2-ethylhexyl hydrogen phosphate |
—— |
C20H46NO4P |
|
—— |
1-Hexanesulfonamide, N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-[2-(phosphonooxy)ethyl]- |
67969-65-7 |
C6F13SO2N(C2H5)CH2CH2OP(=O)(OH)2 |
|
—— |
diethyl phosphate;dimethyl(octadecyl)azanium |
—— |
C24H54NO4P |
|
—— |
6-methylheptyl phosphate;tris(2-hydroxyethyl)azanium |
—— |
C20H49N2O10P |
|
—— |
Decyl hydrogen phosphate;dibutyl(2-hydroxyethyl)azanium |
67969-86-2 |
C20H46NO5P |
|
—— |
2-(Hexyloxy)ethyl dihydrogen phosphate |
63294-54-2 |
C8H19O5P |
|
—— |
Octyl phosphate, diethanolamine salt |
68258-98-0 |
C12H33NO10P2 |
|
—— |
1-Pentanesulfonamide, N-ethyl-1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N-[2-(phosphonooxy)ethyl]- |
67939-90-6 |
C9H11F11NO6PS |
|
—— |
Bis(4-methylpentyl) phosphate;tris(2-hydroxyethyl)azanium |
67953-26-8 |
C18H42NO7P |
|
—— |
1-Nonanol, 8-methyl-, hydrogen phosphate |
67953-31-5 |
C20H43O4P |
|
—— |
1-Heptanesulfonamide, N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoro-N-[2-(phosphonooxy)ethyl]- |
67923-61-9 |
C7F15SO2N(C2H5)CH2CH2OP(=O)(OH)2 |
|
—— |
1-Dodecanaminium, N-dodecyl-N,N-dimethyl-, diisooctyl phosphate (1:1) |
67907-18-0 |
C42H90NO4P |
|
—— |
Didodecyldimethylammonium monoisooctyl phosphate (1:1) |
514801-12-8 |
C34H74NO4P |
|
—— |
1-Butanesulfonamide, N,N'-[phosphinicobis(oxy-2,1-ethanediyl)]bis[N-ethyl-1,1,2,2,3,3,4,4,4-nonafluoro- |
67939-91-7 |
C16H19F18N2O8PS2 |
|
—— |
Diethyl phosphate;methyl(dioctadecyl)azanium |
67873-99-8 |
C41H88NO4P |
|
—— |
dimethyl(octadecyl)azanium;tridecyl hydrogen phosphate |
—— |
C33H72NO4P |
|
—— |
dibutyl(2-hydroxyethyl)azanium;3-methylbutyl octyl phosphate |
—— |
C23H52NO5P |
|
—— |
Bis(2-hydroxyethyl)-octadecylazanium;ethyl hydrogen phosphate |
67874-02-6 |
C24H54NO6P |
|
—— |
Dodecyl(dimethyl)azanium;ethyl hydrogen phosphate |
67846-09-7 |
C16H38NO4P |
|
—— |
Einecs 267-354-8 |
67846-08-6 |
C29H63N4O6P |
|
—— |
dimethyl(octadecyl)azanium;octyl hydrogen phosphate |
—— |
C28H62NO4P |
|
—— |
Bis(2-hydroxyethyl)-octadecylazanium;diethyl phosphate |
67874-01-5 |
C26H58NO6P |
|
—— |
3-Chloro-2,2-dimethylpropyl bis(dichloropropyl) phosphate |
67412-53-7 |
C11H20Cl5O4P |
|
—— |
Phosphoric acid, isooctyl ester, sodium salt |
68186-56-1 |
C8H19NaO5P- |
|